Preferred Name |
Raloxifene |
|
Synonyms |
[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothien-3-yl][4-(2-piperidin-1-ylethoxy)phenyl]methanone Raloxifene raloxifenum (2-(4-Hydroxyphenyl)-6-hydroxybenzo(b)thien-3-yl)(4-(2-(1-piperidinyl)ethoxy)phenyl)methanone LY 139481 raloxifene raloxifeno |
|
Definitions |
A member of the class of 1-benzothiophenes that is 1-benzothiophene in which the hydrogens at positions 2, 3, and 6 have been replaced by p-hydroxyphenyl, p-[2-(piperidin-1-yl)ethoxy]benzoyl, and hydroxy groups, respectively. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8772 |
|
charge |
0 |
|
database_cross_reference |
Drug_Central:2351 KEGG:C07228 CAS:84449-90-1 Patent:EP62503 KEGG:D08465 Patent:US4418068 DrugBank:DB00481 Beilstein:4890356 LINCS:LSM-3425 PDBeChem:RAL Wikipedia:Raloxifene |
|
definition |
A member of the class of 1-benzothiophenes that is 1-benzothiophene in which the hydrogens at positions 2, 3, and 6 have been replaced by p-hydroxyphenyl, p-[2-(piperidin-1-yl)ethoxy]benzoyl, and hydroxy groups, respectively. |
|
formula |
C28H27NO4S |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_50739 |
|
has_alternative_id |
CHEBI:45355 |
|
has_exact_synonym |
[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothien-3-yl][4-(2-piperidin-1-ylethoxy)phenyl]methanone Raloxifene |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
raloxifenum (2-(4-Hydroxyphenyl)-6-hydroxybenzo(b)thien-3-yl)(4-(2-(1-piperidinyl)ethoxy)phenyl)methanone LY 139481 raloxifene raloxifeno |
|
has_RxCUI |
72143 |
|
id |
CHEBI:8772 |
|
in_subset | ||
inchi |
InChI=1S/C28H27NO4S/c30-21-8-4-20(5-9-21)28-26(24-13-10-22(31)18-25(24)34-28)27(32)19-6-11-23(12-7-19)33-17-16-29-14-2-1-3-15-29/h4-13,18,30-31H,1-3,14-17H2 |
|
inchikey |
GZUITABIAKMVPG-UHFFFAOYSA-N |
|
is conjugate base of | ||
label |
Raloxifene raloxifene |
|
mass |
473.585 |
|
monoisotopicmass |
473.16608 |
|
notation |
CHEBI:8772 |
|
prefLabel |
Raloxifene |
|
smiles |
S1C(=C(C2=C1C=C(O)C=C2)C(=O)C3=CC=C(OCCN4CCCCC4)C=C3)C5=CC=C(O)C=C5 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_48737 http://purl.obolibrary.org/obo/CHEBI_33853 |