Preferred Name |
prilocaine |
|
Synonyms |
N-(2-methylphenyl)-N(2)-propylalaninamide 2-Methyl-alpha-propylaminopropionanilide o-Methyl-2-propylaminopropionanilide N-(2-Methylphenyl)-2-(propylamino)propanamide prilocaine base 2-(Propylamino)-o-propionotoluidide Propitocaine prilocainum o-Methyl-alpha-propylaminopropionanilide alpha-n-Propylamino-2-methylpropionanilide prilocaina |
|
Definitions |
An amino acid amide in which N-propyl-DL-alanine and 2-methylaniline have combined to form the amide bond; used as a local anaesthetic. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8404 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D00553 CAS:721-50-6 PMID:26199764 Patent:US3160662 PMID:9989796 KEGG:C07531 Patent:GB839943 LINCS:LSM-5078 PMID:26049614 DrugBank:DB00750 Drug_Central:2265 Beilstein:2108498 Wikipedia:Prilocaine PMID:26356490 |
|
definition |
An amino acid amide in which N-propyl-DL-alanine and 2-methylaniline have combined to form the amide bond; used as a local anaesthetic. |
|
formula |
C13H20N2O |
|
has role | ||
has_alternative_id |
CHEBI:308749 |
|
has_exact_synonym |
N-(2-methylphenyl)-N(2)-propylalaninamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-Methyl-alpha-propylaminopropionanilide o-Methyl-2-propylaminopropionanilide N-(2-Methylphenyl)-2-(propylamino)propanamide prilocaine base 2-(Propylamino)-o-propionotoluidide Propitocaine prilocainum o-Methyl-alpha-propylaminopropionanilide alpha-n-Propylamino-2-methylpropionanilide prilocaina |
|
has_RxCUI |
8686 |
|
id |
CHEBI:8404 |
|
in_subset | ||
inchi |
InChI=1S/C13H20N2O/c1-4-9-14-11(3)13(16)15-12-8-6-5-7-10(12)2/h5-8,11,14H,4,9H2,1-3H3,(H,15,16) |
|
inchikey |
MVFGUOIZUNYYSO-UHFFFAOYSA-N |
|
label |
Prilocaine prilocaine |
|
mass |
220.31070 |
|
monoisotopicmass |
220.15756 |
|
notation |
CHEBI:8404 |
|
prefLabel |
prilocaine |
|
smiles |
CCCNC(C)C(=O)Nc1ccccc1C |
|
subClassOf |