Preferred Name |
etamivan |
|
Synonyms |
N,N-diethyl-4-hydroxy-3-methoxybenzamide etamivan etamivanum ethamivan |
|
Definitions |
Phenol substituted at C-2 and C-4 by a methoxy group and an N,N-diethylaminocarbonyl group respectively. A respiratory stimulant drug related to nikethamide, it has now fallen largely into disuse. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_92675 |
|
charge |
0 |
|
database_cross_reference |
CAS:304-84-7 Drug_Central:1074 PMID:2917015 Wikipedia:Etamivan PMID:14000228 PMID:29438107 |
|
definition |
Phenol substituted at C-2 and C-4 by a methoxy group and an N,N-diethylaminocarbonyl group respectively. A respiratory stimulant drug related to nikethamide, it has now fallen largely into disuse. |
|
formula |
C12H17NO3 |
|
has_exact_synonym |
N,N-diethyl-4-hydroxy-3-methoxybenzamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
etamivan etamivanum ethamivan |
|
has_RxCUI |
24453 |
|
id |
CHEBI:92675 |
|
in_subset | ||
inchi |
InChI=1S/C12H17NO3/c1-4-13(5-2)12(15)9-6-7-10(14)11(8-9)16-3/h6-8,14H,4-5H2,1-3H3 |
|
inchikey |
BQJODPIMMWWMFC-UHFFFAOYSA-N |
|
label |
etamivan ethamivan |
|
mass |
223.269 |
|
monoisotopicmass |
223.12084 |
|
notation |
CHEBI:92675 |
|
prefLabel |
etamivan |
|
smiles |
CCN(CC)C(=O)C1=CC(=C(C=C1)O)OC |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33853 |