Preferred Name |
ixazomib |
|
Synonyms |
N-[(1R)-1-borono-3-methylbutyl]-N(2)-(2,5-dichlorobenzoyl)glycinamide MLN 2238 MLN-2238 MLN2238 ixazomib |
|
Definitions |
A glycine derivative that is the amide obtained by formal condensation of the carboxy group of N-(2,5-dichlorobenzoyl)glycine with the amino group of [(1R)-1-amino-3-methylbutyl]boronic acid. The active metabolite of ixazomib citrate, it is used in combination therapy for treatment of multiple myeloma. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_90942 |
|
charge |
0 |
|
database_cross_reference |
PMID:25377318 PMID:24292417 PMID:25919767 PMID:24239172 KEGG:D10130 PMID:26667773 PMID:26275080 Wikipedia:Ixazomib PMID:25832873 PMID:25124778 PMID:26141494 Drug_Central:5067 PMID:24904120 PMID:23514361 PMID:26709701 PMID:26588946 PMID:25777468 PMID:25456369 PMID:26337806 PMID:26634271 PMID:24467634 PMID:25325301 CAS:1072833-77-2 PMID:25302026 LINCS:LSM-4944 Reaxys:18302358 PMID:24920586 |
|
definition |
A glycine derivative that is the amide obtained by formal condensation of the carboxy group of N-(2,5-dichlorobenzoyl)glycine with the amino group of [(1R)-1-amino-3-methylbutyl]boronic acid. The active metabolite of ixazomib citrate, it is used in combination therapy for treatment of multiple myeloma. |
|
formula |
C14H19BCl2N2O4 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_49103 http://purl.obolibrary.org/obo/CHEBI_52726 |
|
has_exact_synonym |
N-[(1R)-1-borono-3-methylbutyl]-N(2)-(2,5-dichlorobenzoyl)glycinamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
MLN 2238 MLN-2238 MLN2238 ixazomib |
|
has_RxCUI |
1723735 |
|
id |
CHEBI:90942 |
|
in_subset | ||
inchi |
InChI=1S/C14H19BCl2N2O4/c1-8(2)5-12(15(22)23)19-13(20)7-18-14(21)10-6-9(16)3-4-11(10)17/h3-4,6,8,12,22-23H,5,7H2,1-2H3,(H,18,21)(H,19,20)/t12-/m0/s1 |
|
inchikey |
MXAYKZJJDUDWDS-LBPRGKRZSA-N |
|
label |
ixazomib |
|
mass |
361.029 |
|
monoisotopicmass |
360.08149 |
|
notation |
CHEBI:90942 |
|
prefLabel |
ixazomib |
|
smiles |
C(NCC(=O)N[C@@H](CC(C)C)B(O)O)(C1=CC(=CC=C1Cl)Cl)=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_24373 http://purl.obolibrary.org/obo/CHEBI_22702 |