loading...| Preferred Name |
dimethyldithiocarbamate |
|
| Synonyms |
dimethyldithiocarbamic acid(1-) dimethyldithiocarbamic acid anion |
|
| Definitions |
A member of the class of dithiocarbamate anions resulting from the removal of the proton from the dithiocarbamic acid moiety of dimethyldithiocarbamic acid. The major species at pH 7.3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_84293 |
|
| charge |
-1 |
|
| definition |
A member of the class of dithiocarbamate anions resulting from the removal of the proton from the dithiocarbamic acid moiety of dimethyldithiocarbamic acid. The major species at pH 7.3. |
|
| formula |
C3H6NS2 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
dimethyldithiocarbamic acid(1-) dimethyldithiocarbamic acid anion |
|
| id |
CHEBI:84293 |
|
| in_subset | ||
| inchi |
InChI=1S/C3H7NS2/c1-4(2)3(5)6/h1-2H3,(H,5,6)/p-1 |
|
| inchikey |
MZGNSEAPZQGJRB-UHFFFAOYSA-M |
|
| is conjugate base of | ||
| label |
dimethyldithiocarbamate |
|
| mass |
120.21700 |
|
| monoisotopicmass |
119.99472 |
|
| notation |
CHEBI:84293 |
|
| prefLabel |
dimethyldithiocarbamate |
|
| smiles |
CN(C)C([S-])=S |
|
| subClassOf |