Preferred Name |
N,N-dimethylacetamide |
|
Synonyms |
N,N-dimethylacetamide dimethylacetamide |
|
Definitions |
A member of the class of acetamides that is acetamide in which the hydrogens attached to the N atom have been replaced by two methyl groups respectively. Metabolite observed in cancer metabolism. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_84254 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Dimethylacetamide KEGG:C20339 CAS:127-19-5 Reaxys:1737614 PMID:25518943 |
|
definition |
A member of the class of acetamides that is acetamide in which the hydrogens attached to the N atom have been replaced by two methyl groups respectively. Metabolite observed in cancer metabolism. |
|
formula |
C4H9NO |
|
has functional parent | ||
has role | ||
has_exact_synonym |
N,N-dimethylacetamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
dimethylacetamide |
|
has_RxCUI |
1368874 |
|
id |
CHEBI:84254 |
|
in_subset | ||
inchi |
InChI=1S/C4H9NO/c1-4(6)5(2)3/h1-3H3 |
|
inchikey |
FXHOOIRPVKKKFG-UHFFFAOYSA-N |
|
label |
N,N-dimethylacetamide dimethylacetamide |
|
mass |
87.12040 |
|
monoisotopicmass |
87.06841 |
|
notation |
CHEBI:84254 |
|
prefLabel |
N,N-dimethylacetamide |
|
smiles |
CN(C)C(C)=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22160 |