loading...| Preferred Name |
tedizolid |
|
| Synonyms |
DA 7157 DA-7157 TR 700 TR-700 Torezolid tedizolid (5R)-3-{3-fluoro-4-[6-(2-methyl-2H-tetrazol-5-yl)pyridin-3-yl]phenyl}-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
|
| Definitions |
A member of the class of pyridines that is pyridine which is substituted by a 2-methyl-2H-tetrazol-5-yl group at position 2 and by a 2-fluoro-4-[(5R)-5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl group at position 5. It is used as its phosphate pro-drug used for the treatment of acute bacterial skin and skin structure infections caused by certain susceptible bacteria, including Staphylococcus aureus (including methicillin-resistant strains (MRSA) and methicillin-susceptible strains), various Streptococcus species, and Enterococcus faecalis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_82717 |
|
| alternative label |
DA 7157 DA-7157 TR 700 TR-700 Torezolid tedizolid (5R)-3-{3-fluoro-4-[6-(2-methyl-2H-tetrazol-5-yl)pyridin-3-yl]phenyl}-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
|
| charge |
0 |
|
| database_cross_reference |
PMID:24989138 PMID:23589680 PMID:24875463 KEGG:D09685 PMID:24708819 PMID:23926058 PMID:25136028 PMID:25136024 PMID:24688035 PMID:24343828 PMID:24343829 PMID:23571550 PMID:25246392 PMID:25266820 PMID:25136252 PMID:25210412 Reaxys:10589936 PMID:24343830 PMID:24343833 PMID:24343832 PMID:25238753 CAS:856866-72-3 PMID:24909499 Wikipedia:Tedizolid |
|
| definition |
A member of the class of pyridines that is pyridine which is substituted by a 2-methyl-2H-tetrazol-5-yl group at position 2 and by a 2-fluoro-4-[(5R)-5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl group at position 5. It is used as its phosphate pro-drug used for the treatment of acute bacterial skin and skin structure infections caused by certain susceptible bacteria, including Staphylococcus aureus (including methicillin-resistant strains (MRSA) and methicillin-susceptible strains), various Streptococcus species, and Enterococcus faecalis. |
|
| formula |
C17H15FN6O3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_49103 |
|
| has_exact_synonym |
(5R)-3-{3-fluoro-4-[6-(2-methyl-2H-tetrazol-5-yl)pyridin-3-yl]phenyl}-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
DA 7157 DA-7157 TR 700 TR-700 Torezolid tedizolid |
|
| has_RxCUI |
1540825 |
|
| id |
CHEBI:82717 |
|
| in_subset | ||
| inchi |
InChI=1S/C17H15FN6O3/c1-23-21-16(20-22-23)15-5-2-10(7-19-15)13-4-3-11(6-14(13)18)24-8-12(9-25)27-17(24)26/h2-7,12,25H,8-9H2,1H3/t12-/m1/s1 |
|
| inchikey |
XFALPSLJIHVRKE-GFCCVEGCSA-N |
|
| label |
tedizolid |
|
| mass |
370.338 |
|
| monoisotopicmass |
370.11897 |
|
| notation |
CHEBI:82717 |
|
| prefLabel |
tedizolid |
|
| smiles |
C1=C(C=CC(=C1F)C2=CN=C(C=C2)C=3N=NN(N3)C)N4C(O[C@H](C4)CO)=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_37143 http://purl.obolibrary.org/obo/CHEBI_55374 http://purl.obolibrary.org/obo/CHEBI_26421 http://purl.obolibrary.org/obo/CHEBI_35689 |