Preferred Name |
Piroxicam |
|
Synonyms |
4-hydroxy-2-methyl-N-pyridin-2-yl-2H-1,2-benzothiazine-3-carboxamide 1,1-dioxide Piroxicam piroxicamum 4-Hydroxy-2-methyl-N-(2-pyridyl)-2H-1,2-benzothiazin-3-caboxyamid-1,1-dioxid FELDENE Feldene Pyroxycam piroxicam |
|
Definitions |
A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of 4-hydroxy-2-methyl-2H-1,2-benzothiazine-3-carboxylic acid 1,1-dioxide with the exocyclic nitrogen of 2-aminopyridine. A non-steroidal anti-inflammatory drug of the oxicam class, it is used to relieve pain and works by preventing the production of endogenous prostaglandins involved in the mediation of pain, stiffness, tenderness and swelling. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8249 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D00127 Wikipedia:Piroxicam HMDB:HMDB0014694 Patent:DE1943265 KEGG:C01608 Reaxys:627692 PMID:12154043 DrugBank:DB00554 PMID:28166217 CAS:36322-90-4 PMID:11142413 Patent:US3591584 Beilstein:627692 Drug_Central:2210 |
|
definition |
A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of 4-hydroxy-2-methyl-2H-1,2-benzothiazine-3-carboxylic acid 1,1-dioxide with the exocyclic nitrogen of 2-aminopyridine. A non-steroidal anti-inflammatory drug of the oxicam class, it is used to relieve pain and works by preventing the production of endogenous prostaglandins involved in the mediation of pain, stiffness, tenderness and swelling. |
|
formula |
C15H13N3O4S |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35480 |
|
has_exact_synonym |
4-hydroxy-2-methyl-N-pyridin-2-yl-2H-1,2-benzothiazine-3-carboxamide 1,1-dioxide Piroxicam |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
piroxicamum 4-Hydroxy-2-methyl-N-(2-pyridyl)-2H-1,2-benzothiazin-3-caboxyamid-1,1-dioxid FELDENE Feldene Pyroxycam piroxicam |
|
has_RxCUI |
8356 |
|
id |
CHEBI:8249 |
|
in_subset | ||
inchi |
InChI=1S/C15H13N3O4S/c1-18-13(15(20)17-12-8-4-5-9-16-12)14(19)10-6-2-3-7-11(10)23(18,21)22/h2-9,19H,1H3,(H,16,17,20) |
|
inchikey |
QYSPLQLAKJAUJT-UHFFFAOYSA-N |
|
label |
Piroxicam piroxicam |
|
mass |
331.34600 |
|
monoisotopicmass |
331.06268 |
|
notation |
CHEBI:8249 |
|
prefLabel |
Piroxicam |
|
smiles |
CN1C(C(=O)Nc2ccccn2)=C(O)c2ccccc2S1(=O)=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_46899 |