Preferred Name |
oxaprozin |
|
Synonyms |
3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoic acid oxaprozinum Danoprox Daypro Dayrun Deflam Duraprox Walix oxaprozin oxaprozina oxaprozine |
|
Definitions |
A monocarboxylic acid that is a propionic acid derivative having a 4,5-diphenyl-1,3-oxazol-2-yl substituent at position 3. It is non-steroidal anti-inflammatory drug commonly used to relieve the pain and inflammatory responses associated with osteoarthritis and rheumatoid arthritis. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_7822 |
|
charge |
0 |
|
database_cross_reference |
PMID:20206429 PMID:19672323 Patent:US3578671 PMID:6863578 PMID:23865335 CAS:21256-18-8 Drug_Central:2013 PMID:1603605 PMID:385873 PMID:6611288 PMID:1617910 Wikipedia:Oxaprozin PMID:9459947 HMDB:HMDB0015126 KEGG:D00463 PMID:6432657 KEGG:C07356 DrugBank:DB00991 Patent:WO2007082542 Reaxys:1083168 Patent:FR2001036 Patent:GB1206403 PMID:19338579 LINCS:LSM-2553 |
|
definition |
A monocarboxylic acid that is a propionic acid derivative having a 4,5-diphenyl-1,3-oxazol-2-yl substituent at position 3. It is non-steroidal anti-inflammatory drug commonly used to relieve the pain and inflammatory responses associated with osteoarthritis and rheumatoid arthritis. |
|
formula |
C18H15NO3 |
|
has functional parent | ||
has role | ||
has_exact_synonym |
3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
oxaprozinum Danoprox Daypro Dayrun Deflam Duraprox Walix oxaprozin oxaprozina oxaprozine |
|
has_RxCUI |
32613 |
|
id |
CHEBI:7822 |
|
in_subset | ||
inchi |
InChI=1S/C18H15NO3/c20-16(21)12-11-15-19-17(13-7-3-1-4-8-13)18(22-15)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,20,21) |
|
inchikey |
OFPXSFXSNFPTHF-UHFFFAOYSA-N |
|
label |
oxaprozin |
|
mass |
293.31660 |
|
monoisotopicmass |
293.10519 |
|
notation |
CHEBI:7822 |
|
prefLabel |
oxaprozin |
|
smiles |
OC(=O)CCc1nc(-c2ccccc2)c(o1)-c1ccccc1 |
|
subClassOf |