Preferred Name |
Oseltamivir |
|
Synonyms |
ethyl (3R,4R,5S)-4-acetamido-5-amino-3-(pentan-3-yloxy)cyclohex-1-ene-1-carboxylate Oseltamivir (-)-oseltamivir Ethyl (3R,4R,5S)-4-acetamido-5-amino-3-(1-ethylpropoxy)-1-cyclohexene-1-carboxylate oseltamivir 1-Cyclohexene-1-carboxylic acid, 4-(acetylamino)-5-amino-3-(1-ethylpropoxy)-, ethyl ester, (3R-(3alpha,4beta,5alpha))- oseltamivirum Agucort GS-4104 HSDB 7433 Tamiflu |
|
Definitions |
A cyclohexenecarboxylate ester that is the ethyl ester of oseltamivir acid. An antiviral prodrug (it is hydrolysed to the active free carboxylic acid in the liver), it is used to slow the spread of influenza. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_7798 |
|
charge |
0 |
|
database_cross_reference |
KEGG:C08092 PMID:18559644 PMID:19439487 PMID:18936828 Drug_Central:2001 PMID:11075941 PMID:19884755 Patent:US5763483 PMID:11270942 CAS:196618-13-0 PMID:17912363 HMDB:HMDB0014343 Reaxys:8003908 KEGG:D08306 PMID:19557131 DrugBank:DB00198 Wikipedia:Oseltamivir Beilstein:8003908 PMID:11825310 PMID:19355841 |
|
definition |
A cyclohexenecarboxylate ester that is the ethyl ester of oseltamivir acid. An antiviral prodrug (it is hydrolysed to the active free carboxylic acid in the liver), it is used to slow the spread of influenza. |
|
formula |
C16H28N2O4 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_52425 |
|
has_alternative_id |
CHEBI:42582 |
|
has_exact_synonym |
ethyl (3R,4R,5S)-4-acetamido-5-amino-3-(pentan-3-yloxy)cyclohex-1-ene-1-carboxylate Oseltamivir |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(-)-oseltamivir Ethyl (3R,4R,5S)-4-acetamido-5-amino-3-(1-ethylpropoxy)-1-cyclohexene-1-carboxylate oseltamivir 1-Cyclohexene-1-carboxylic acid, 4-(acetylamino)-5-amino-3-(1-ethylpropoxy)-, ethyl ester, (3R-(3alpha,4beta,5alpha))- oseltamivirum Agucort GS-4104 HSDB 7433 Tamiflu |
|
has_RxCUI |
260101 |
|
id |
CHEBI:7798 |
|
in_subset | ||
inchi |
InChI=1S/C16H28N2O4/c1-5-12(6-2)22-14-9-11(16(20)21-7-3)8-13(17)15(14)18-10(4)19/h9,12-15H,5-8,17H2,1-4H3,(H,18,19)/t13-,14+,15+/m0/s1 |
|
inchikey |
VSZGPKBBMSAYNT-RRFJBIMHSA-N |
|
label |
oseltamivir Oseltamivir |
|
mass |
312.40450 |
|
monoisotopicmass |
312.20491 |
|
notation |
CHEBI:7798 |
|
prefLabel |
Oseltamivir |
|
smiles |
CCOC(=O)C1=C[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22160 http://purl.obolibrary.org/obo/CHEBI_46668 |