Preferred Name |
Dexketoprofen |
|
Synonyms |
(2S)-2-(3-benzoylphenyl)propanoic acid (+)-(S)-m-Benzoylhydratropic acid dexketoprofen (+)-3-Benzoylhydratropic acid (S)-Ketoprofen (S)-3-Benzoyl-alpha-methylbenzeneacetic acid (+)-Ketoprofen |
|
Definitions |
A monocarboxylic acid that is (S)-hydratropic acid substituted at position 3 on the phenyl ring by a benzoyl group. A cyclooxygenase inhibitor, it is used to relieve short-term pain, such as muscular pain, dental pain and dysmenorrhoea. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_76128 |
|
charge |
0 |
|
database_cross_reference |
PMID:22081874 Wikipedia:Dexketoprofen PMID:23630432 Patent:WO2008150324 Patent:WO2005046575 KEGG:D07269 PMID:22425338 PMID:23407378 Patent:WO2008115572 LINCS:LSM-5547 PMID:23562407 HMDB:HMDB0041873 PMID:23891968 PMID:23360885 PMID:22577544 Drug_Central:833 PMID:23298631 PMID:23127168 PMID:23208967 Reaxys:5271646 CAS:22161-81-5 PMID:23695075 |
|
definition |
A monocarboxylic acid that is (S)-hydratropic acid substituted at position 3 on the phenyl ring by a benzoyl group. A cyclooxygenase inhibitor, it is used to relieve short-term pain, such as muscular pain, dental pain and dysmenorrhoea. |
|
formula |
C16H14O3 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_50629 http://purl.obolibrary.org/obo/CHEBI_35475 |
|
has_exact_synonym |
(2S)-2-(3-benzoylphenyl)propanoic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(+)-(S)-m-Benzoylhydratropic acid dexketoprofen (+)-3-Benzoylhydratropic acid (S)-Ketoprofen (S)-3-Benzoyl-alpha-methylbenzeneacetic acid (+)-Ketoprofen |
|
has_RxCUI |
237162 |
|
id |
CHEBI:76128 |
|
in_subset | ||
inchi |
InChI=1S/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19)/t11-/m0/s1 |
|
inchikey |
DKYWVDODHFEZIM-NSHDSACASA-N |
|
label |
dexketoprofen Dexketoprofen |
|
mass |
254.28060 |
|
monoisotopicmass |
254.09429 |
|
notation |
CHEBI:76128 |
|
prefLabel |
Dexketoprofen |
|
smiles |
C[C@H](C(O)=O)c1cccc(c1)C(=O)c1ccccc1 |
|
subClassOf |