Preferred Name |
canagliflozin |
|
Synonyms |
(1S)-1,5-anhydro-1-(3-{[5-(4-fluorophenyl)-2-thienyl]methyl}-4-methylphenyl)-D-glucitol 1-(Glucopyranosyl)-4-methyl-3-(5-(4-fluorophenyl)-2-thienylmethyl)benzene |
|
Definitions |
A C-glycosyl compound that is used (in its hemihydrate form) for treatment of type II diabetes via inhibition of sodium-glucose transport protein subtype 2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_73274 |
|
charge |
0 |
|
database_cross_reference |
PMID:23585665 PMID:23087012 Patent:WO2009035969 PMID:23412078 Patent:US2012289694 Wikipedia:Canagliflozin PMID:22355316 PMID:21457428 PMID:23370138 PMID:23590413 PMID:23563279 Patent:US2010099883 Reaxys:18362681 Drug_Central:4758 PMID:22621689 PMID:22548646 PMID:22385274 PMID:23564919 Patent:WO2011142478 PMID:22492586 PMID:22632452 PMID:23464594 PMID:22226086 PMID:23279307 CAS:842133-18-0 PMID:20690635 Patent:US2008146515 |
|
definition |
A C-glycosyl compound that is used (in its hemihydrate form) for treatment of type II diabetes via inhibition of sodium-glucose transport protein subtype 2. |
|
formula |
C24H25FO5S |
|
has role | ||
has_exact_synonym |
(1S)-1,5-anhydro-1-(3-{[5-(4-fluorophenyl)-2-thienyl]methyl}-4-methylphenyl)-D-glucitol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1-(Glucopyranosyl)-4-methyl-3-(5-(4-fluorophenyl)-2-thienylmethyl)benzene |
|
has_RxCUI |
1373458 |
|
id |
CHEBI:73274 |
|
in_subset | ||
inchi |
InChI=1S/C24H25FO5S/c1-13-2-3-15(24-23(29)22(28)21(27)19(12-26)30-24)10-16(13)11-18-8-9-20(31-18)14-4-6-17(25)7-5-14/h2-10,19,21-24,26-29H,11-12H2,1H3/t19-,21-,22+,23-,24+/m1/s1 |
|
inchikey |
XTNGUQKDFGDXSJ-ZXGKGEBGSA-N |
|
label |
canagliflozin |
|
mass |
444.518 |
|
monoisotopicmass |
444.14067 |
|
notation |
CHEBI:73274 |
|
prefLabel |
canagliflozin |
|
smiles |
[C@@H]1([C@@H]([C@H]([C@@](O[C@@H]1CO)(C2=CC=C(C(=C2)CC=3SC(=CC3)C4=CC=C(C=C4)F)C)[H])O)O)O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_20857 |