Preferred Name |
Meperidine |
|
Synonyms |
ethyl 1-methyl-4-phenylpiperidine-4-carboxylate 1-methyl-4-phenylpiperidine-4-carboxylic acid ethyl ester isonipecaine ethyl 1-methyl-4-phenylisonipecotate N-methyl-4-phenyl-4-carbethoxypiperidine pethidineter 1-methyl-4-phenylisonipecotic acid ethyl ester 1-methyl-4-phenyl-4-piperidinecarboxylic acid ethyl ester methyl phenylpiperidine carbonic acid ethyl ester Demerol IDS-NP-001 Meperidol Nemerol Pethanol meperidina meperidine pethidin pethidine pethidinum petidina petydyna phetidine |
|
Definitions |
A piperidinecarboxylate ester that is piperidine which is substituted by a methyl group at position 1 and by phenyl and ethoxycarbonyl groups at position 4. It is an analgesic which is used for the treatment of moderate to severe pain, including postoperative pain and labour pain. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6754 |
|
charge |
0 |
|
database_cross_reference |
PMID:30786304 PMID:30362203 DrugBank:DB00454 CAS:57-42-1 KEGG:D08343 PMID:32214301 HMDB:HMDB0014597 PMID:30902024 PMID:31001434 PMID:31294134 PMID:31874879 PMID:30487674 PMID:32001961 PMID:27621675 PMID:29880084 PMID:28666300 PMID:30386603 PMID:31319637 Wikipedia:Pethidine PMID:31633090 PMID:30418234 PMID:31423145 PMID:30115484 Drug_Central:1690 KEGG:C07128 PMID:31486253 PMID:30902579 |
|
definition |
A piperidinecarboxylate ester that is piperidine which is substituted by a methyl group at position 1 and by phenyl and ethoxycarbonyl groups at position 4. It is an analgesic which is used for the treatment of moderate to severe pain, including postoperative pain and labour pain. |
|
formula |
C15H21NO2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_53784 http://purl.obolibrary.org/obo/CHEBI_55322 |
|
has_exact_synonym |
ethyl 1-methyl-4-phenylpiperidine-4-carboxylate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1-methyl-4-phenylpiperidine-4-carboxylic acid ethyl ester isonipecaine ethyl 1-methyl-4-phenylisonipecotate N-methyl-4-phenyl-4-carbethoxypiperidine pethidineter 1-methyl-4-phenylisonipecotic acid ethyl ester 1-methyl-4-phenyl-4-piperidinecarboxylic acid ethyl ester methyl phenylpiperidine carbonic acid ethyl ester Demerol IDS-NP-001 Meperidol Nemerol Pethanol meperidina meperidine pethidin pethidine pethidinum petidina petydyna phetidine |
|
has_RxCUI |
6754 |
|
id |
CHEBI:6754 |
|
in_subset | ||
inchi |
InChI=1S/C15H21NO2/c1-3-18-14(17)15(9-11-16(2)12-10-15)13-7-5-4-6-8-13/h4-8H,3,9-12H2,1-2H3 |
|
inchikey |
XADCESSVHJOZHK-UHFFFAOYSA-N |
|
is conjugate base of | ||
label |
Meperidine pethidine |
|
mass |
247.338 |
|
monoisotopicmass |
247.15723 |
|
notation |
CHEBI:6754 |
|
prefLabel |
Meperidine |
|
smiles |
C1(C(=O)OCC)(CCN(CC1)C)C2=CC=CC=C2 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_23990 |