Preferred Name |
ivacaftor |
|
Synonyms |
ivacaftorum Kalydeco VX-770 ivacaftor N-(2,4-di-tert-butyl-5-hydroxyphenyl)-4-oxo-1,4-dihydroquinoline-3-carboxamide |
|
Definitions |
An aromatic amide obtained by formal condensation of the carboxy group of 4-oxo-1,4-dihydroquinoline-3-carboxylic acid with the amino group of 5-amino-2,4-di-tert-butylphenol. Used for the treatment of cystic fibrosis. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_66901 |
|
alternative label |
ivacaftorum Kalydeco VX-770 ivacaftor N-(2,4-di-tert-butyl-5-hydroxyphenyl)-4-oxo-1,4-dihydroquinoline-3-carboxamide |
|
charge |
0 |
|
database_cross_reference |
PMID:22543461 PMID:22383668 PMID:22499233 CAS:873054-44-5 PMID:22293084 Wikipedia:Ivacaftor PMID:22698459 PMID:22768130 Drug_Central:4228 PMID:22508750 Reaxys:11821038 PMID:22739718 KEGG:D09916 PMID:22618984 PMID:22047557 PMID:22723294 |
|
definition |
An aromatic amide obtained by formal condensation of the carboxy group of 4-oxo-1,4-dihydroquinoline-3-carboxylic acid with the amino group of 5-amino-2,4-di-tert-butylphenol. Used for the treatment of cystic fibrosis. |
|
formula |
C24H28N2O3 |
|
has role | ||
has_exact_synonym |
N-(2,4-di-tert-butyl-5-hydroxyphenyl)-4-oxo-1,4-dihydroquinoline-3-carboxamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
ivacaftorum Kalydeco VX-770 ivacaftor |
|
has_RxCUI |
1243041 |
|
id |
CHEBI:66901 |
|
in_subset | ||
inchi |
InChI=1S/C24H28N2O3/c1-23(2,3)16-11-17(24(4,5)6)20(27)12-19(16)26-22(29)15-13-25-18-10-8-7-9-14(18)21(15)28/h7-13,27H,1-6H3,(H,25,28)(H,26,29) |
|
inchikey |
PURKAOJPTOLRMP-UHFFFAOYSA-N |
|
label |
ivacaftor |
|
mass |
392.49070 |
|
monoisotopicmass |
392.20999 |
|
notation |
CHEBI:66901 |
|
prefLabel |
ivacaftor |
|
smiles |
CC(C)(C)c1cc(c(NC(=O)c2c[nH]c3ccccc3c2=O)cc1O)C(C)(C)C |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_62733 http://purl.obolibrary.org/obo/CHEBI_33853 |