loading...| Preferred Name |
valganciclovir |
|
| Synonyms |
2-[(2-amino-6-oxo-3,6-dihydro-9H-purin-9-yl)methoxy]-3-hydroxypropyl L-valinate valganciclovir |
|
| Definitions |
The L-valinyl ester of ganciclovir, into which it is rapidly converted by intestinal and hepatic esterases. It is a synthetic analogue of 2'-deoxyguanosine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_63635 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:175865-60-8 KEGG:D02495 Drug_Central:2801 Wikipedia:Valganciclovir DrugBank:DB01610 Reaxys:14503833 |
|
| definition |
The L-valinyl ester of ganciclovir, into which it is rapidly converted by intestinal and hepatic esterases. It is a synthetic analogue of 2'-deoxyguanosine. |
|
| formula |
C14H22N6O5 |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
2-[(2-amino-6-oxo-3,6-dihydro-9H-purin-9-yl)methoxy]-3-hydroxypropyl L-valinate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
valganciclovir |
|
| has_RxCUI |
275891 |
|
| id |
CHEBI:63635 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H22N6O5/c1-7(2)9(15)13(23)24-4-8(3-21)25-6-20-5-17-10-11(20)18-14(16)19-12(10)22/h5,7-9,21H,3-4,6,15H2,1-2H3,(H3,16,18,19,22)/t8?,9-/m0/s1 |
|
| inchikey |
WPVFJKSGQUFQAP-GKAPJAKFSA-N |
|
| label |
valganciclovir |
|
| mass |
354.36170 |
|
| monoisotopicmass |
354.16517 |
|
| notation |
CHEBI:63635 |
|
| prefLabel |
valganciclovir |
|
| smiles |
CC(C)[C@H](N)C(=O)OCC(CO)OCn1cnc2c1[nH]c(N)nc2=O |
|
| subClassOf |