loading...| Preferred Name |
Zinc Acetate |
|
| Synonyms |
Acetic acid, zinc(II) salt Zinc acetate anhydrous Acetic acid, zinc salt (2:1) Zinc(II) acetate zinc diacetate Zinc di(acetate) acetic acid, zinc salt Dicarbomethoxyzinc Zn(II)Ac2 Zn(OAc)2 |
|
| Definitions |
An acetate salt in which the cationic component is zinc(2+). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_62984 |
|
| alternative label |
Acetic acid, zinc(II) salt Zinc acetate anhydrous Acetic acid, zinc salt (2:1) Zinc(II) acetate zinc diacetate Zinc di(acetate) acetic acid, zinc salt Dicarbomethoxyzinc Zn(II)Ac2 Zn(OAc)2 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:557-34-6 PMID:21109379 PMID:20634118 Reaxys:3563830 PMID:21381680 |
|
| definition |
An acetate salt in which the cationic component is zinc(2+). |
|
| formula |
C4H6O4Zn |
|
| has role | ||
| has_exact_synonym |
zinc diacetate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Acetic acid, zinc(II) salt Zinc acetate anhydrous Acetic acid, zinc salt (2:1) Zinc(II) acetate zinc diacetate Zinc di(acetate) acetic acid, zinc salt Dicarbomethoxyzinc Zn(II)Ac2 Zn(OAc)2 |
|
| has_RxCUI |
58295 |
|
| id |
CHEBI:62984 |
|
| in_subset | ||
| inchi |
InChI=1S/2C2H4O2.Zn/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
|
| inchikey |
DJWUNCQRNNEAKC-UHFFFAOYSA-L |
|
| label |
Zinc Acetate zinc acetate |
|
| mass |
183.49700 |
|
| monoisotopicmass |
181.95575 |
|
| notation |
CHEBI:62984 |
|
| prefLabel |
Zinc Acetate |
|
| smiles |
[Zn++].CC([O-])=O.CC([O-])=O |
|
| subClassOf |