Preferred Name |
Hydroflumethiazide |
|
Synonyms |
Hydroflumethiazide 6-(trifluoromethyl)-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide hidroflumetiazida hydroflumethiazide trifluoromethylhydrothiazide hydroflumethiazidum |
|
Definitions |
A benzothiadiazine consisting of a 3,4-dihydro-HH-1,2,4-benzothiadiazine bicyclic system dioxygenated on sulfur and carrying trifluoromethyl and aminosulfonyl groups at positions 6 and 7 respectively. A diuretic with actions and uses similar to those of hydrochlorothiazide. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5784 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Hydroflumethiazide PMID:632365 Reaxys:342692 PMID:477714 KEGG:C07763 PMID:14407732 KEGG:D00654 CAS:135-09-1 Drug_Central:1392 LINCS:LSM-5497 PMID:2490778 PMID:29438107 |
|
definition |
A benzothiadiazine consisting of a 3,4-dihydro-HH-1,2,4-benzothiadiazine bicyclic system dioxygenated on sulfur and carrying trifluoromethyl and aminosulfonyl groups at positions 6 and 7 respectively. A diuretic with actions and uses similar to those of hydrochlorothiazide. |
|
formula |
C8H8F3N3O4S2 |
|
has role | ||
has_exact_synonym |
Hydroflumethiazide 6-(trifluoromethyl)-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
hidroflumetiazida hydroflumethiazide trifluoromethylhydrothiazide hydroflumethiazidum |
|
has_RxCUI |
5495 |
|
id |
CHEBI:5784 |
|
in_subset | ||
inchi |
InChI=1S/C8H8F3N3O4S2/c9-8(10,11)4-1-5-7(2-6(4)19(12,15)16)20(17,18)14-3-13-5/h1-2,13-14H,3H2,(H2,12,15,16) |
|
inchikey |
DMDGGSIALPNSEE-UHFFFAOYSA-N |
|
is_bearer_of | ||
label |
hydroflumethiazide Hydroflumethiazide |
|
mass |
331.295 |
|
monoisotopicmass |
330.99083 |
|
notation |
CHEBI:5784 |
|
prefLabel |
Hydroflumethiazide |
|
smiles |
C12=C(C=C(S(N)(=O)=O)C(=C1)C(F)(F)F)S(NCN2)(=O)=O |
|
subClassOf |