loading...| Preferred Name |
Cladribine |
|
| Synonyms |
2-chloro-6-amino-9-(2-deoxy-beta-D-erythro-pentofuranosyl)purine cladribinum (2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol 2-chloro-deoxyadenosine 2-chloro-2'-deoxy-beta-adenosine 2-chlorodeoxyadenosine 2-CdA 2ClAdo CldAdo cladribina cladribine 2-chloro-2'-deoxyadenosine Cladribine |
|
| Definitions |
2'-Deoxyadenosine in which the hydrogen at position 2 on the purine ring has been substituted by chlorine. It inhibits the synthesis and repair of DNA, particularly in lymphocytes and monocytes, and is used as an antimetabolite antineoplastic drug for the treatment of lymphoid malignancies including hairy-cell leukaemia and chronic lymphocytic leukaemia. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_567361 |
|
| alternative label |
2-chloro-6-amino-9-(2-deoxy-beta-D-erythro-pentofuranosyl)purine cladribinum (2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol 2-chloro-deoxyadenosine 2-chloro-2'-deoxy-beta-adenosine 2-chlorodeoxyadenosine 2-CdA 2ClAdo CldAdo cladribina cladribine 2-chloro-2'-deoxyadenosine Cladribine |
|
| charge |
0 |
|
| database_cross_reference |
Drug_Central:667 PMID:17526755 Beilstein:624220 PMID:26024233 DrugBank:DB00242 CAS:4291-63-8 Patent:US4760137 LINCS:LSM-5976 KEGG:D01370 Patent:EP173059 Wikipedia:Cladribine PMID:18570408 |
|
| definition |
2'-Deoxyadenosine in which the hydrogen at position 2 on the purine ring has been substituted by chlorine. It inhibits the synthesis and repair of DNA, particularly in lymphocytes and monocytes, and is used as an antimetabolite antineoplastic drug for the treatment of lymphoid malignancies including hairy-cell leukaemia and chronic lymphocytic leukaemia. |
|
| formula |
C10H12ClN5O3 |
|
| has role | ||
| has_alternative_id |
CHEBI:31407 CHEBI:568373 |
|
| has_exact_synonym |
2-chloro-2'-deoxyadenosine Cladribine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-chloro-6-amino-9-(2-deoxy-beta-D-erythro-pentofuranosyl)purine cladribinum (2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol 2-chloro-deoxyadenosine 2-chloro-2'-deoxy-beta-adenosine 2-chlorodeoxyadenosine 2-CdA 2ClAdo CldAdo cladribina cladribine |
|
| has_RxCUI |
44157 |
|
| id |
CHEBI:567361 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H12ClN5O3/c11-10-14-8(12)7-9(15-10)16(3-13-7)6-1-4(18)5(2-17)19-6/h3-6,17-18H,1-2H2,(H2,12,14,15)/t4-,5+,6+/m0/s1 |
|
| inchikey |
PTOAARAWEBMLNO-KVQBGUIXSA-N |
|
| label |
Cladribine cladribine |
|
| mass |
285.68700 |
|
| monoisotopicmass |
285.06287 |
|
| notation |
CHEBI:567361 |
|
| prefLabel |
Cladribine |
|
| smiles |
Nc1nc(Cl)nc2n(cnc12)[C@H]1C[C@H](O)[C@@H](CO)O1 |
|
| subClassOf |