loading...| Preferred Name |
Granisetron |
|
| Synonyms |
1-methyl-N-[(3-endo)-9-methyl-9-azabicyclo[3.3.1]non-3-yl]-1H-indazole-3-carboxamide granisetronum granisetron 1-methyl-N-(9-methyl-endo-9-azabicyclo(3.3.1)non-3-yl)-1H-indazole-3-carboxamide APF 530 APF530 BRL 43694 Kevatril Sancuso Sustol |
|
| Definitions |
A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of 1-methyl-1H-indazole-3-carboxylic acid with the primary amino group of (3-endo)-9-methyl-9-azabicyclo[3.3.1]nonan-3-amine. A selective 5-HT3 receptor antagonist, it is used (generally as the monohydrochloride salt) to manage nausea and vomiting caused by cancer chemotherapy and radiotherapy, and to prevent and treat postoperative nausea and vomiting. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5537 |
|
| charge |
0 |
|
| database_cross_reference |
Drug_Central:1329 Patent:US4886808 PMID:24388937 PMID:27571447 CAS:109889-09-0 PMID:27184113 PMID:28211304 PMID:27358385 PMID:27162748 PMID:27382819 PMID:2540014 DrugBank:DB00889 PMID:27915445 PMID:28061543 PMID:26812081 PMID:26289588 PMID:28168082 PMID:27186139 KEGG:D04370 Reaxys:3655275 PMID:1650335 PMID:2169778 PMID:25834466 PMID:22452942 PMID:25866983 PMID:27129842 Wikipedia:Granisetron PMID:26925101 PMID:26997579 PMID:27746523 PDBeChem:CWB PMID:27650869 HMDB:HMDB0015026 PMID:27073822 PMID:27895421 PMID:27400689 KEGG:C07023 Patent:EP200444 PMID:27809336 PMID:27703112 PMID:28002447 |
|
| definition |
A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of 1-methyl-1H-indazole-3-carboxylic acid with the primary amino group of (3-endo)-9-methyl-9-azabicyclo[3.3.1]nonan-3-amine. A selective 5-HT3 receptor antagonist, it is used (generally as the monohydrochloride salt) to manage nausea and vomiting caused by cancer chemotherapy and radiotherapy, and to prevent and treat postoperative nausea and vomiting. |
|
| formula |
C18H24N4O |
|
| has role | ||
| has_exact_synonym |
1-methyl-N-[(3-endo)-9-methyl-9-azabicyclo[3.3.1]non-3-yl]-1H-indazole-3-carboxamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
granisetronum granisetron 1-methyl-N-(9-methyl-endo-9-azabicyclo(3.3.1)non-3-yl)-1H-indazole-3-carboxamide APF 530 APF530 BRL 43694 Kevatril Sancuso Sustol |
|
| has_RxCUI |
26237 |
|
| id |
CHEBI:5537 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H24N4O/c1-21-13-6-5-7-14(21)11-12(10-13)19-18(23)17-15-8-3-4-9-16(15)22(2)20-17/h3-4,8-9,12-14H,5-7,10-11H2,1-2H3,(H,19,23)/t12-,13+,14- |
|
| inchikey |
MFWNKCLOYSRHCJ-BTTYYORXSA-N |
|
| label |
granisetron Granisetron |
|
| mass |
312.40940 |
|
| monoisotopicmass |
312.19501 |
|
| notation |
CHEBI:5537 |
|
| prefLabel |
Granisetron |
|
| smiles |
CN1[C@H]2CCC[C@@H]1C[C@@H](C2)NC(=O)c1nn(C)c2ccccc12 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_29347 |