loading...| Preferred Name |
2-diethylaminoethanol |
|
| Synonyms |
2-(diethylamino)ethanol N,N-diethyl-N-(beta-hydroxyethyl)amine beta-hydroxytriethylamine diethylethanolamine N,N-Diethyl-2-aminoethanol Diethyl(2-hydroxyethyl)amine diethylmonoethanolamine N,N-Diethylethanolamine Diethylaminoethanol beta-(diethylamino)ethyl alcohol DEAE |
|
| Definitions |
A member of the class of ethanolamines that is aminoethanol in which the hydrogens of the amino group are replaced by ethyl groups. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_52153 |
|
| charge |
0 |
|
| database_cross_reference |
HMDB:HMDB0033971 Beilstein:741863 Reaxys:741863 CAS:100-37-8 Wikipedia:2-Diethylaminoethanol PMID:22325017 |
|
| definition |
A member of the class of ethanolamines that is aminoethanol in which the hydrogens of the amino group are replaced by ethyl groups. |
|
| formula |
C6H15NO |
|
| has functional parent | ||
| has parent hydride | ||
| has_exact_synonym |
2-(diethylamino)ethanol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
N,N-diethyl-N-(beta-hydroxyethyl)amine beta-hydroxytriethylamine diethylethanolamine N,N-Diethyl-2-aminoethanol Diethyl(2-hydroxyethyl)amine diethylmonoethanolamine N,N-Diethylethanolamine Diethylaminoethanol beta-(diethylamino)ethyl alcohol DEAE |
|
| id |
CHEBI:52153 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H15NO/c1-3-7(4-2)5-6-8/h8H,3-6H2,1-2H3 |
|
| inchikey |
BFSVOASYOCHEOV-UHFFFAOYSA-N |
|
| label |
2-diethylaminoethanol |
|
| mass |
117.18940 |
|
| monoisotopicmass |
117.11536 |
|
| notation |
CHEBI:52153 |
|
| prefLabel |
2-diethylaminoethanol |
|
| smiles |
CCN(CC)CCO |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_23981 |