loading...| Preferred Name |
triclocarban |
|
| Synonyms |
1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea N-(4-chlorophenyl)-N'-(3,4-dichlorophenyl)urea triclocarbanum triclocarban 3,4,4'-trichlorocarbanilide 3,4,4'-trichloro carbanilide 1-(3',4'-dichlorophenyl)-3-(4'-chlorophenyl)urea 3,4,4'-trichlorodiphenylurea Cutisan Nobacter Solubacter TCC |
|
| Definitions |
A member of the class of phenylureas that is urea substituted by a 4-chlorophenyl group and a 3,4-dichlorophenyl group at positions 1 and 3 respectively. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_48347 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB11155 PMID:30033524 Patent:US2818390 CAS:101-20-2 Wikipedia:Triclocarban Beilstein:2814890 Reaxys:2814890 KEGG:D06223 Patent:GB769273 Drug_Central:3630 PMID:24562054 PMID:18048496 PMID:24461429 PMID:24464075 |
|
| definition |
A member of the class of phenylureas that is urea substituted by a 4-chlorophenyl group and a 3,4-dichlorophenyl group at positions 1 and 3 respectively. |
|
| formula |
C13H9Cl3N2O |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_48218 |
|
| has_exact_synonym |
1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
N-(4-chlorophenyl)-N'-(3,4-dichlorophenyl)urea triclocarbanum triclocarban 3,4,4'-trichlorocarbanilide 3,4,4'-trichloro carbanilide 1-(3',4'-dichlorophenyl)-3-(4'-chlorophenyl)urea 3,4,4'-trichlorodiphenylurea Cutisan Nobacter Solubacter TCC |
|
| has_RxCUI |
38609 |
|
| id |
CHEBI:48347 |
|
| in_subset | ||
| inchi |
InChI=1S/C13H9Cl3N2O/c14-8-1-3-9(4-2-8)17-13(19)18-10-5-6-11(15)12(16)7-10/h1-7H,(H2,17,18,19) |
|
| inchikey |
ICUTUKXCWQYESQ-UHFFFAOYSA-N |
|
| label |
triclocarban |
|
| mass |
315.58200 |
|
| monoisotopicmass |
313.97805 |
|
| notation |
CHEBI:48347 |
|
| prefLabel |
triclocarban |
|
| smiles |
Clc1ccc(NC(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_134043 |