Preferred Name |
Dimenhydrinate |
|
Synonyms |
2-(diphenylmethoxy)-N,N-dimethylethanaminium 8-chloro-1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydropurin-7-ide dimenhydrinatum beta-dimethylaminoethyl benzhydryl ether 1,3-dimethyl-8-chloroxanthine 8-chloro-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - 2-(diphenylmethoxy)-N,N-dimethylethanamine (1:1) diphenhydramine 8-chlorotheophyllinate O-benzhydryldimethylaminoethanol 8-chlorotheophyllinate dimenhydrinate Benzhydryl-beta-dimethylaminoethylether 8-chlorotheophylline dimenhidrinato diphenhydramine 8-chlorotheophylline (O-benzhydryl(dimethylamino)ethanol) 8-chlorotheophyllinate diphenhydramine theoclate N,N-dimethyl-2-diphenylmethoxyethylamine 8-chlorotheophyllinate |
|
Definitions |
The diphenhydramine salt of 8-chlorotheophylline. Its effects are similar to those of diphenhydramine, but it is less potent. It was thought that by combining the antiemetic effects of diphenhydramine with the mild stimulant effects of 8-chlorotheophyline, the extreme drowsiness induced by the former would be mitigated. However, the sedation caused by diphenhydramine is considerably stronger than the stimulation caused by 8-chlorotheophylline. Dimenhydrinate is used mainly as an antiemetic in the prevention and treatment of motion sickness. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4604 |
|
charge |
0 |
|
database_cross_reference |
Patent:US2499058 Patent:US2534813 KEGG:D00520 DrugBank:DB00985 CAS:523-87-5 |
|
definition |
The diphenhydramine salt of 8-chlorotheophylline. Its effects are similar to those of diphenhydramine, but it is less potent. It was thought that by combining the antiemetic effects of diphenhydramine with the mild stimulant effects of 8-chlorotheophyline, the extreme drowsiness induced by the former would be mitigated. However, the sedation caused by diphenhydramine is considerably stronger than the stimulation caused by 8-chlorotheophylline. Dimenhydrinate is used mainly as an antiemetic in the prevention and treatment of motion sickness. |
|
formula |
C24H28ClN5O3 |
|
has part | ||
has role | ||
has_exact_synonym |
2-(diphenylmethoxy)-N,N-dimethylethanaminium 8-chloro-1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydropurin-7-ide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
dimenhydrinatum beta-dimethylaminoethyl benzhydryl ether 1,3-dimethyl-8-chloroxanthine 8-chloro-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - 2-(diphenylmethoxy)-N,N-dimethylethanamine (1:1) diphenhydramine 8-chlorotheophyllinate O-benzhydryldimethylaminoethanol 8-chlorotheophyllinate dimenhydrinate Benzhydryl-beta-dimethylaminoethylether 8-chlorotheophylline dimenhidrinato diphenhydramine 8-chlorotheophylline (O-benzhydryl(dimethylamino)ethanol) 8-chlorotheophyllinate diphenhydramine theoclate N,N-dimethyl-2-diphenylmethoxyethylamine 8-chlorotheophyllinate |
|
has_RxCUI |
3444 |
|
id |
CHEBI:4604 |
|
in_subset | ||
inchi |
InChI=1S/C17H21NO.C7H7ClN4O2/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16;1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h3-12,17H,13-14H2,1-2H3;1-2H3,(H,9,10,13) |
|
inchikey |
DKHVTDUUNTVKOW-UHFFFAOYSA-N |
|
label |
Dimenhydrinate dimenhydrinate |
|
mass |
469.96400 |
|
monoisotopicmass |
469.18807 |
|
notation |
CHEBI:4604 |
|
prefLabel |
Dimenhydrinate |
|
smiles |
Cn1c2nc(Cl)[n-]c2c(=O)n(C)c1=O.C[NH+](C)CCOC(c1ccccc1)c1ccccc1 |
|
subClassOf |