Preferred Name |
ciclopirox |
|
Synonyms |
6-cyclohexyl-1-hydroxy-4-methylpyridin-2(1H)-one ciclopiroxum 6-cyclohexyl-1-hydroxy-4-methyl-2(1H)-pyridinone ciclopirox |
|
Definitions |
A cyclic hydroxamic acid that is 1-hydroxypyridin-2(1H)-one in which the hydrogens at positions 4 and 6 are substituted by methyl and cyclohexyl groups, respectively. A broad spectrum antigfungal agent, it also exhibits antibacterial activity against many Gram-positive and Gram-negative bacteria, and has anti-inflammatory properties. It is used a a topical treatment of fungal skin and nail infections. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_453011 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Ciclopirox KEGG:D03488 DrugBank:DB01188 Patent:US3883545 PMID:16854048 LINCS:LSM-5307 CAS:29342-05-0 Beilstein:1533423 Drug_Central:636 PMID:17253868 |
|
definition |
A cyclic hydroxamic acid that is 1-hydroxypyridin-2(1H)-one in which the hydrogens at positions 4 and 6 are substituted by methyl and cyclohexyl groups, respectively. A broad spectrum antigfungal agent, it also exhibits antibacterial activity against many Gram-positive and Gram-negative bacteria, and has anti-inflammatory properties. It is used a a topical treatment of fungal skin and nail infections. |
|
formula |
C12H17NO2 |
|
has role | ||
has_exact_synonym |
6-cyclohexyl-1-hydroxy-4-methylpyridin-2(1H)-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
ciclopiroxum 6-cyclohexyl-1-hydroxy-4-methyl-2(1H)-pyridinone ciclopirox |
|
has_RxCUI |
21090 |
|
id |
CHEBI:453011 |
|
in_subset | ||
inchi |
InChI=1S/C12H17NO2/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10/h7-8,10,15H,2-6H2,1H3 |
|
inchikey |
SCKYRAXSEDYPSA-UHFFFAOYSA-N |
|
label |
ciclopirox |
|
mass |
207.26890 |
|
monoisotopicmass |
207.12593 |
|
notation |
CHEBI:453011 |
|
prefLabel |
ciclopirox |
|
smiles |
Cc1cc(C2CCCCC2)n(O)c(=O)c1 |
|
subClassOf |