loading...| Preferred Name |
kojic acid |
|
| Synonyms |
5-hydroxy-2-(hydroxymethyl)-4H-pyran-4-one Kojic acid acido kojico 5-Hydroxy-2-(hydroxymethyl)-4-pyrone 5-hydroxy-2-hydroxymethyl-4-pyrone Kojisaeure |
|
| Definitions |
A pyranone that is 4H-pyran substituted by a hydroxy group at position 5, a hydroxymethyl group at position 2 and an oxo group at position 4. It has been isolated from the fungus Aspergillus oryzae. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_43572 |
|
| charge |
0 |
|
| database_cross_reference |
Patent:JP2013017408 PMID:20943172 PMID:1348188 PMID:15039076 Gmelin:3620 PMID:7714722 Wikipedia:Kojic_acid DrugBank:DB01759 Beilstein:120895 CAS:501-30-4 KEGG:C14516 MetaCyc:KOJIC-ACID PDBeChem:KOJ PMID:18083129 PMID:8987542 PMID:11534762 Patent:AU2012268879 PMID:24116376 HMDB:HMDB0032923 PMID:28166217 PMID:19471877 Reaxys:120895 Drug_Central:3977 PMID:16198580 PMID:23683589 |
|
| definition |
A pyranone that is 4H-pyran substituted by a hydroxy group at position 5, a hydroxymethyl group at position 2 and an oxo group at position 4. It has been isolated from the fungus Aspergillus oryzae. |
|
| formula |
C6H6O4 |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_85050 http://purl.obolibrary.org/obo/CHEBI_59997 http://purl.obolibrary.org/obo/CHEBI_85046 http://purl.obolibrary.org/obo/CHEBI_85051 http://purl.obolibrary.org/obo/CHEBI_76956 http://purl.obolibrary.org/obo/CHEBI_85052 |
|
| has_alternative_id |
CHEBI:34805 CHEBI:43568 |
|
| has_exact_synonym |
5-hydroxy-2-(hydroxymethyl)-4H-pyran-4-one Kojic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
acido kojico 5-Hydroxy-2-(hydroxymethyl)-4-pyrone 5-hydroxy-2-hydroxymethyl-4-pyrone Kojisaeure |
|
| has_RxCUI |
1426451 |
|
| id |
CHEBI:43572 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H6O4/c7-2-4-1-5(8)6(9)3-10-4/h1,3,7,9H,2H2 |
|
| inchikey |
BEJNERDRQOWKJM-UHFFFAOYSA-N |
|
| label |
kojic acid |
|
| mass |
142.10940 |
|
| monoisotopicmass |
142.02661 |
|
| notation |
CHEBI:43572 |
|
| prefLabel |
kojic acid |
|
| smiles |
OCc1cc(=O)c(O)co1 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33823 |