loading...| Preferred Name |
nitenpyram |
|
| Synonyms |
N-[(6-chloropyridin-3-yl)methyl]-N-ethyl-N'-methyl-2-nitroethene-1,1-diamine |
|
| Definitions |
A C-nitro compound consisting of 2-nitroethene-1,1-diamine where one of the nitrogens bears ethyl and (6-chloro-3-pyridinyl)methyl while the other nitrogen carries a methyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_39171 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:8553513 PMID:21714058 Beilstein:8553513 PMID:10789501 |
|
| definition |
A C-nitro compound consisting of 2-nitroethene-1,1-diamine where one of the nitrogens bears ethyl and (6-chloro-3-pyridinyl)methyl while the other nitrogen carries a methyl group. |
|
| formula |
C11H15ClN4O2 |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
N-[(6-chloropyridin-3-yl)methyl]-N-ethyl-N'-methyl-2-nitroethene-1,1-diamine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_RxCUI |
341379 |
|
| id |
CHEBI:39171 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H15ClN4O2/c1-3-15(11(13-2)8-16(17)18)7-9-4-5-10(12)14-6-9/h4-6,8,13H,3,7H2,1-2H3 |
|
| inchikey |
CFRPSFYHXJZSBI-UHFFFAOYSA-N |
|
| label |
nitenpyram |
|
| mass |
270.71500 |
|
| monoisotopicmass |
270.08835 |
|
| notation |
CHEBI:39171 |
|
| prefLabel |
nitenpyram |
|
| smiles |
[H]C(=C(NC)N(CC)Cc1ccc(Cl)nc1)[N+]([O-])=O |
|
| subClassOf |