Preferred Name |
Acriflavine |
|
Synonyms |
3,6-diamino-10-methylacridinium chloride acriflavine trypaflavine C.I. 46000 |
|
Definitions |
The 10-methochloride salt of 3,6-diaminoacridine. Note that a mixture of this compound with 3,6-diaminoacridine (proflavine) is known as acriflavine or neutral acriflavine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_383703 |
|
charge |
0 |
|
database_cross_reference |
CAS:86-40-8 Reaxys:3579028 PMID:6737429 |
|
definition |
The 10-methochloride salt of 3,6-diaminoacridine. Note that a mixture of this compound with 3,6-diaminoacridine (proflavine) is known as acriflavine or neutral acriflavine. |
|
formula |
C14H14ClN3 |
|
has part | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_24853 http://purl.obolibrary.org/obo/CHEBI_33282 http://purl.obolibrary.org/obo/CHEBI_50903 |
|
has_exact_synonym |
3,6-diamino-10-methylacridinium chloride |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
acriflavine trypaflavine C.I. 46000 |
|
has_RxCUI |
249 |
|
id |
CHEBI:383703 |
|
in_subset | ||
inchi |
InChI=1S/C14H13N3.ClH/c1-17-13-7-11(15)4-2-9(13)6-10-3-5-12(16)8-14(10)17;/h2-8H,1H3,(H3,15,16);1H |
|
inchikey |
KKAJSJJFBSOMGS-UHFFFAOYSA-N |
|
label |
Acriflavine 3,6-diamino-10-methylacridinium chloride |
|
mass |
259.73400 |
|
monoisotopicmass |
259.08763 |
|
notation |
CHEBI:383703 |
|
prefLabel |
Acriflavine |
|
smiles |
[Cl-].C[n+]1c2cc(N)ccc2cc2ccc(N)cc12 |
|
subClassOf |