Preferred Name |
clidinium |
|
Synonyms |
3-{[hydroxy(diphenyl)acetyl]oxy}-1-methyl-1-azoniabicyclo[2.2.2]octane CLIDINIUM Clidinium 3-hydroxy-1-methylquinuclidinium benzilate ester N-methyl quinuclidinyl benzilate 3-(2-Hydroxy-2,2-diphenyl-acetoxy)-1-methyl-1-azonia-bicyclo[2.2.2]octane |
|
Definitions |
The ester resulting from formal condensation of benzilic acid and 3-hydroxy-1-methyl-1-azoniabicyclo[2.2.2]octane. It is used, generally as the bromide, for the symptomatic treatment of peptic ulcer disease and also to help relieve abdominal or stomach spasms or cramps due to colicky abdominal pain, diverticulitis, and irritable bowel syndrome. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3743 |
|
charge |
+1 |
|
database_cross_reference |
Beilstein:8798002 KEGG:C07853 DrugBank:DB00771 CAS:7020-55-5 |
|
definition |
The ester resulting from formal condensation of benzilic acid and 3-hydroxy-1-methyl-1-azoniabicyclo[2.2.2]octane. It is used, generally as the bromide, for the symptomatic treatment of peptic ulcer disease and also to help relieve abdominal or stomach spasms or cramps due to colicky abdominal pain, diverticulitis, and irritable bowel syndrome. |
|
formula |
C22H26NO3 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_38070 |
|
has_alternative_id |
CHEBI:126351 |
|
has_exact_synonym |
3-{[hydroxy(diphenyl)acetyl]oxy}-1-methyl-1-azoniabicyclo[2.2.2]octane CLIDINIUM Clidinium |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
3-hydroxy-1-methylquinuclidinium benzilate ester N-methyl quinuclidinyl benzilate 3-(2-Hydroxy-2,2-diphenyl-acetoxy)-1-methyl-1-azonia-bicyclo[2.2.2]octane |
|
has_RxCUI |
21232 |
|
id |
CHEBI:3743 |
|
in_subset | ||
inchi |
InChI=1S/C22H26NO3/c1-23-14-12-17(13-15-23)20(16-23)26-21(24)22(25,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,17,20,25H,12-16H2,1H3/q+1/t17-,20?,23+ |
|
inchikey |
HOOSGZJRQIVJSZ-NNBUQUNQSA-N |
|
label |
clidinium |
|
mass |
352.44670 |
|
monoisotopicmass |
352.19072 |
|
notation |
CHEBI:3743 |
|
prefLabel |
clidinium |
|
smiles |
C[N@@+]12CC[C@@H](CC1)C(C2)OC(=O)C(O)(c1ccccc1)c1ccccc1 |
|
subClassOf |