loading...| Preferred Name |
triethylamine |
|
| Synonyms |
Triaethylamin N,N-Diethylethanamine Triethylamin (diethylamino)ethane N,N,N-triethylamine (C2H5)3N NEt3 TEA TEN N,N-diethylethanamine Triethylamine |
|
| Definitions |
A tertiary amine that is ammonia in which each hydrogen atom is substituted by an ethyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_35026 |
|
| alternative label |
Triaethylamin N,N-Diethylethanamine Triethylamin (diethylamino)ethane N,N,N-triethylamine (C2H5)3N NEt3 TEA TEN N,N-diethylethanamine Triethylamine |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:605283 Reaxys:605283 CAS:121-44-8 PDBeChem:TEA HMDB:HMDB0032539 PMID:24359525 Gmelin:2455 Wikipedia:Triethylamine MetaCyc:TRIETHYLAMINE KEGG:C14691 |
|
| definition |
A tertiary amine that is ammonia in which each hydrogen atom is substituted by an ethyl group. |
|
| formula |
C6H15N |
|
| has_exact_synonym |
N,N-diethylethanamine Triethylamine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Triaethylamin N,N-Diethylethanamine Triethylamin (diethylamino)ethane N,N,N-triethylamine (C2H5)3N NEt3 TEA TEN |
|
| has_RxCUI |
1307097 |
|
| id |
CHEBI:35026 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H15N/c1-4-7(5-2)6-3/h4-6H2,1-3H3 |
|
| inchikey |
ZMANZCXQSJIPKH-UHFFFAOYSA-N |
|
| label |
triethylamine |
|
| mass |
101.19004 |
|
| monoisotopicmass |
101.12045 |
|
| notation |
CHEBI:35026 |
|
| prefLabel |
triethylamine |
|
| smiles |
CCN(CC)CC |
|
| subClassOf |