Preferred Name |
Pentylenetetrazole |
|
Synonyms |
6,7,8,9-tetrahydro-5H-tetrazolo[1,5-a]azepine Pentetrazol 6,7,8,9-tetrahydro-5-azepotetrazole Cardiotonicum alpha,beta-cyclopentamethylenetetrazole pentamethylene-1,5-tetrazole pentylenetetrazol Pentylenetetrazole 1,5-pentamethylenetetrazole Cardifortan pentetrazol pentetrazolum 7,8,9,10-tetrazabicyclo[5.3.0]-8,10-decadiene Cardiazol Cardiazole Cardosal Cardosan Cenalene-M Cenazol Coranormol Coratoline Corazol Corazole Corvasol Coryvet Deumacard Diovascole Gewazol Kardiazol Korazol Metrazol Phrenazol Ventrazol |
|
Definitions |
An organic heterobicyclic compound that is 1H-tetrazole in which the hydrogens at positions 1 and 5 are replaced by a pentane-1,5-diyl group. A central and respiratory stimulant, it was formerly used for the treatment of cough and other respiratory tract disorders, cardiovascular disorders including hypotension, and pruritis. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_34910 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D07409 PMID:23893477 CAS:54-95-5 LINCS:LSM-3287 Wikipedia:Pentylenetetrazol PMID:22049436 Reaxys:135492 PMID:24397543 PMID:21689733 PMID:23852314 Patent:US1599493 Patent:US1564631 PMID:19797046 Drug_Central:3428 KEGG:C13692 |
|
definition |
An organic heterobicyclic compound that is 1H-tetrazole in which the hydrogens at positions 1 and 5 are replaced by a pentane-1,5-diyl group. A central and respiratory stimulant, it was formerly used for the treatment of cough and other respiratory tract disorders, cardiovascular disorders including hypotension, and pruritis. |
|
formula |
C6H10N4 |
|
has_exact_synonym |
6,7,8,9-tetrahydro-5H-tetrazolo[1,5-a]azepine Pentetrazol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
6,7,8,9-tetrahydro-5-azepotetrazole 6,7,8,9-tetrahydro-5H-tetrazolo[1,5-a]azepine Cardiotonicum alpha,beta-cyclopentamethylenetetrazole pentamethylene-1,5-tetrazole pentylenetetrazol Pentylenetetrazole 1,5-pentamethylenetetrazole Cardifortan pentetrazol pentetrazolum 7,8,9,10-tetrazabicyclo[5.3.0]-8,10-decadiene Cardiazol Cardiazole Cardosal Cardosan Cenalene-M Cenazol Coranormol Coratoline Corazol Corazole Corvasol Coryvet Deumacard Diovascole Gewazol Kardiazol Korazol Metrazol Phrenazol Ventrazol |
|
has_RxCUI |
8015 |
|
id |
CHEBI:34910 |
|
in_subset | ||
inchi |
InChI=1S/C6H10N4/c1-2-4-6-7-8-9-10(6)5-3-1/h1-5H2 |
|
inchikey |
CWRVKFFCRWGWCS-UHFFFAOYSA-N |
|
label |
Pentylenetetrazole pentetrazol |
|
mass |
138.17040 |
|
monoisotopicmass |
138.09055 |
|
notation |
CHEBI:34910 |
|
prefLabel |
Pentylenetetrazole |
|
smiles |
C1CCc2nnnn2CC1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38101 |