loading...| Preferred Name |
methyl methacrylate |
|
| Synonyms |
Methyl methacrylate Methyl-methacrylat Methyl 2-methyl-2-propenoate Methyl methylacrylate Methyl alpha-methylacrylate Methacrylate de methyle Methyl 2-methylacrylate Methyl 2-methylpropenoate 2-(Methoxycarbonyl)-1-propene Methylmethacrylate Methacrylsaeuremethyl ester Methacrylic acid methyl ester 2-Methyl-2-propenoic acid methyl ester 2-Methylacrylic acid methyl ester MMA |
|
| Definitions |
An enoate ester having methacrylic acid as the carboxylic acid component and methanol as the alcohol component. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_34840 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:605459 Wikipedia:Methyl_methacrylate PMID:23508285 PMID:23342990 KEGG:C14527 PMID:23583434 HMDB:HMDB0032385 Beilstein:605459 PMID:23584430 PMID:23306624 PMID:23242048 PMID:22566411 Gmelin:2691 PMID:23450227 CAS:80-62-6 PMID:23719017 PMID:9036138 PMID:16020090 PMID:23432523 PMID:11714252 PMID:10444249 |
|
| definition |
An enoate ester having methacrylic acid as the carboxylic acid component and methanol as the alcohol component. |
|
| formula |
C5H8O2 |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
Methyl methacrylate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Methyl-methacrylat Methyl 2-methyl-2-propenoate Methyl methylacrylate Methyl alpha-methylacrylate Methacrylate de methyle Methyl 2-methylacrylate Methyl 2-methylpropenoate 2-(Methoxycarbonyl)-1-propene Methylmethacrylate Methacrylsaeuremethyl ester Methacrylic acid methyl ester 2-Methyl-2-propenoic acid methyl ester 2-Methylacrylic acid methyl ester MMA |
|
| has_RxCUI |
29897 |
|
| id |
CHEBI:34840 |
|
| in_subset | ||
| inchi |
InChI=1S/C5H8O2/c1-4(2)5(6)7-3/h1H2,2-3H3 |
|
| inchikey |
VVQNEPGJFQJSBK-UHFFFAOYSA-N |
|
| label |
methyl methacrylate Methylmethacrylate |
|
| mass |
100.117 |
|
| monoisotopicmass |
100.05243 |
|
| notation |
CHEBI:34840 |
|
| prefLabel |
methyl methacrylate |
|
| smiles |
COC(C(C)=C)=O |
|
| subClassOf |