loading...| Preferred Name |
Butylated Hydroxytoluene |
|
| Synonyms |
2,6-di-tert-butyl-4-methylphenol 2,6-di-tert-butyl-1-hydroxy-4-methylbenzene 2,6-bis(1,1-dimethylethyl)-4-methylphenol 2,6-di-t-butyl-p-cresol o-di-tert-butyl-p-methylphenol 2,6-di-tert-butyl-4-hydroxytoluene 1-hydroxy-4-methyl-2,6-di-tert-butylbenzene butylated hydroxytoluene 2,6-di-tert-butyl-4-cresol 2,6-di-t-butyl-4-methylphenol butylhydroxytoluene 2,6-di-tert-butyl-4-methylhydroxybenzene 2,6-di-tert-butyl-p-cresol BHT FEMA 2184 |
|
| Definitions |
A member of the class of phenols that is 4-methylphenol substituted by tert-butyl groups at positions 2 and 6. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_34247 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:11837686 KEGG:D02413 PMID:33091556 PMID:32387881 Reaxys:1911640 PMID:29864697 Beilstein:1911640 CAS:128-37-0 PMID:32304926 PMID:24612426 LINCS:LSM-19020 Chemspider:13835296 PMID:34013795 PMID:33792845 HMDB:HMDB0033826 PMID:34041400 FooDB:FDB011992 PMID:448040 PMID:32397407 PMID:31029976 Wikipedia:Butylated_hydroxytoluene KEGG:C14693 PMID:32963880 PMID:24617543 PMID:33039371 PMID:32322261 PMID:31780362 PMID:34443068 PMID:33519739 |
|
| definition |
A member of the class of phenols that is 4-methylphenol substituted by tert-butyl groups at positions 2 and 6. |
|
| formula |
C15H24O |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_22586 http://purl.obolibrary.org/obo/CHEBI_176497 |
|
| has_exact_synonym |
2,6-di-tert-butyl-4-methylphenol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2,6-di-tert-butyl-1-hydroxy-4-methylbenzene 2,6-bis(1,1-dimethylethyl)-4-methylphenol 2,6-di-t-butyl-p-cresol o-di-tert-butyl-p-methylphenol 2,6-di-tert-butyl-4-hydroxytoluene 1-hydroxy-4-methyl-2,6-di-tert-butylbenzene butylated hydroxytoluene 2,6-di-tert-butyl-4-cresol 2,6-di-t-butyl-4-methylphenol butylhydroxytoluene 2,6-di-tert-butyl-4-methylhydroxybenzene 2,6-di-tert-butyl-p-cresol BHT FEMA 2184 |
|
| has_RxCUI |
1848 |
|
| id |
CHEBI:34247 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H24O/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7/h8-9,16H,1-7H3 |
|
| inchikey |
NLZUEZXRPGMBCV-UHFFFAOYSA-N |
|
| label |
2,6-di-tert-butyl-4-methylphenol Butylated Hydroxytoluene |
|
| mass |
220.35046 |
|
| monoisotopicmass |
220.18272 |
|
| notation |
CHEBI:34247 |
|
| prefLabel |
Butylated Hydroxytoluene |
|
| smiles |
Cc1cc(c(O)c(c1)C(C)(C)C)C(C)(C)C |
|
| subClassOf |