Preferred Name |
propylparaben |
|
Synonyms |
p-Hydroxypropyl benzoate p-Oxybenzoesaeurepropylester n-Propyl 4-hydroxybenzoate n-propyl paraben 4-Hydroxybenzoic acid, propyl ester propyl paraben p-Hydroxybenzoic acid propyl ester 4-Hydroxybenzoic acid propyl ester p-Hydroxybenzoic propyl ester n-Propyl p-hydroxybenzoate Propyl parahydroxybenzoate Propyl p-hydroxybenzoate propyl 4-hydroxybenzoate |
|
Definitions |
The benzoate ester that is the propyl ester of 4-hydroxybenzoic acid. Preservative typically found in many water-based cosmetics, such as creams, lotions, shampoos and bath products. Also used as a food additive. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_32063 |
|
alternative label |
p-Hydroxypropyl benzoate p-Oxybenzoesaeurepropylester n-Propyl 4-hydroxybenzoate n-propyl paraben 4-Hydroxybenzoic acid, propyl ester propyl paraben p-Hydroxybenzoic acid propyl ester 4-Hydroxybenzoic acid propyl ester p-Hydroxybenzoic propyl ester n-Propyl p-hydroxybenzoate Propyl parahydroxybenzoate Propyl p-hydroxybenzoate propyl 4-hydroxybenzoate |
|
charge |
0 |
|
database_cross_reference |
PMID:21549034 KEGG:D01422 PMID:21608130 PMID:22249112 PMID:22237600 PMID:22177019 CAS:94-13-3 PMID:22305363 PMID:21645663 PMID:22337803 Reaxys:1103245 HMDB:HMDB0032574 Drug_Central:2307 PMID:22220814 PMID:21492176 PMID:21886901 PMID:21705745 Wikipedia:Propylparaben PMID:22165009 |
|
definition |
The benzoate ester that is the propyl ester of 4-hydroxybenzoic acid. Preservative typically found in many water-based cosmetics, such as creams, lotions, shampoos and bath products. Also used as a food additive. |
|
formula |
C10H12O3 |
|
has functional parent | ||
has role | ||
has_exact_synonym |
propyl 4-hydroxybenzoate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
p-Hydroxypropyl benzoate p-Oxybenzoesaeurepropylester n-Propyl 4-hydroxybenzoate n-propyl paraben 4-Hydroxybenzoic acid, propyl ester propyl paraben p-Hydroxybenzoic acid propyl ester 4-Hydroxybenzoic acid propyl ester p-Hydroxybenzoic propyl ester n-Propyl p-hydroxybenzoate Propyl parahydroxybenzoate Propyl p-hydroxybenzoate |
|
has_RxCUI |
34706 |
|
id |
CHEBI:32063 |
|
in_subset | ||
inchi |
InChI=1S/C10H12O3/c1-2-7-13-10(12)8-3-5-9(11)6-4-8/h3-6,11H,2,7H2,1H3 |
|
inchikey |
QELSKZZBTMNZEB-UHFFFAOYSA-N |
|
label |
propylparaben |
|
mass |
180.20050 |
|
monoisotopicmass |
180.07864 |
|
notation |
CHEBI:32063 |
|
prefLabel |
propylparaben |
|
smiles |
CCCOC(=O)c1ccc(O)cc1 |
|
subClassOf |