loading...| Preferred Name |
buclizine |
|
| Synonyms |
1-(4-tert-butylbenzyl)-4-[(4-chlorophenyl)(phenyl)methyl]piperazine Buclizine 1-(p-tert-Butylbenzyl)-4-(4-chloro-alpha-phenylbenzyl)piperazine buclizina buclizine buclizinum |
|
| Definitions |
An N-alkylpiperazine carrying (4-chlorophenyl)(phenyl)methyl and 4-tert-butylbenzyl groups. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3205 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D07547 HMDB:HMDB0014498 Wikipedia:Buclizine KEGG:C07777 PMID:13620483 Patent:GB1311286 CAS:82-95-1 Patent:US2709169 Drug_Central:416 Reaxys:349567 PMID:14428806 Beilstein:349567 PMID:22469258 PMID:4387177 DrugBank:DB00354 PMID:5304814 |
|
| definition |
An N-alkylpiperazine carrying (4-chlorophenyl)(phenyl)methyl and 4-tert-butylbenzyl groups. |
|
| formula |
C28H33ClN2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_37956 http://purl.obolibrary.org/obo/CHEBI_48873 http://purl.obolibrary.org/obo/CHEBI_36333 |
|
| has_exact_synonym |
1-(4-tert-butylbenzyl)-4-[(4-chlorophenyl)(phenyl)methyl]piperazine Buclizine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1-(p-tert-Butylbenzyl)-4-(4-chloro-alpha-phenylbenzyl)piperazine buclizina buclizine buclizinum |
|
| has_RxCUI |
59636 |
|
| id |
CHEBI:3205 |
|
| in_subset | ||
| inchi |
InChI=1S/C28H33ClN2/c1-28(2,3)25-13-9-22(10-14-25)21-30-17-19-31(20-18-30)27(23-7-5-4-6-8-23)24-11-15-26(29)16-12-24/h4-16,27H,17-21H2,1-3H3 |
|
| inchikey |
MOYGZHXDRJNJEP-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
buclizine |
|
| mass |
433.02780 |
|
| monoisotopicmass |
432.23323 |
|
| notation |
CHEBI:3205 |
|
| prefLabel |
buclizine |
|
| smiles |
CC(C)(C)c1ccc(CN2CCN(CC2)C(c2ccccc2)c2ccc(Cl)cc2)cc1 |
|
| subClassOf |