loading...| Preferred Name |
pirfenidone |
|
| Synonyms |
5-methyl-1-phenylpyridin-2(1H)-one pirfenidonum pirfenidona pirfenidone AMR 69 AMR-69 Esbriet |
|
| Definitions |
A pyridone that is 2-pyridone substituted at positions 1 and 5 by phenyl and methyl groups respectively. An anti-inflammatory drug used for the treatment of idiopathic pulmonary fibrosis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_32016 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:1526549 PMID:25738437 PMID:25596380 PMID:25639750 Wikipedia:Pirfenidone PMID:25459156 Drug_Central:4224 PMID:25593606 PMID:25432946 PMID:25624597 Reaxys:1526549 KEGG:D01583 PMID:25726556 PMID:25678074 PMID:25727967 CAS:53179-13-8 PMID:25604027 PMID:25542603 PMID:25691376 LINCS:LSM-4190 |
|
| definition |
A pyridone that is 2-pyridone substituted at positions 1 and 5 by phenyl and methyl groups respectively. An anti-inflammatory drug used for the treatment of idiopathic pulmonary fibrosis. |
|
| formula |
C12H11NO |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35493 |
|
| has_exact_synonym |
5-methyl-1-phenylpyridin-2(1H)-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
pirfenidonum pirfenidona pirfenidone AMR 69 AMR-69 Esbriet |
|
| has_RxCUI |
1592254 |
|
| id |
CHEBI:32016 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H11NO/c1-10-7-8-12(14)13(9-10)11-5-3-2-4-6-11/h2-9H,1H3 |
|
| inchikey |
ISWRGOKTTBVCFA-UHFFFAOYSA-N |
|
| label |
pirfenidone |
|
| mass |
185.22180 |
|
| monoisotopicmass |
185.08406 |
|
| notation |
CHEBI:32016 |
|
| prefLabel |
pirfenidone |
|
| smiles |
Cc1ccc(=O)n(c1)-c1ccccc1 |
|
| subClassOf |