loading...| Preferred Name |
4-hydroxybenzoic acid |
|
| Synonyms |
4-carboxyphenol P-HYDROXYBENZOIC ACID p-salicylic acid p-hydroxybenzoic acid 4-hydroxybenzoic acid 4-Hydroxybenzoic acid |
|
| Definitions |
A monohydroxybenzoic acid that is benzoic acid carrying a hydroxy substituent at C-4 of the benzene ring. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30763 |
|
| alternative label |
4-carboxyphenol P-HYDROXYBENZOIC ACID p-salicylic acid p-hydroxybenzoic acid 4-hydroxybenzoic acid 4-Hydroxybenzoic acid |
|
| charge |
0 |
|
| database_cross_reference |
PMID:24128482 CAS:99-96-7 KNApSAcK:C00000856 DrugBank:DB04242 YMDB:YMDB00495 Beilstein:970950 PDBeChem:PHB ECMDB:ECMDB00500 PMID:24236566 KEGG:C00156 PMID:22770225 HMDB:HMDB0000500 Gmelin:3102 Reaxys:970950 Wikipedia:4-Hydroxybenzoic_acid PMID:17185273 |
|
| definition |
A monohydroxybenzoic acid that is benzoic acid carrying a hydroxy substituent at C-4 of the benzene ring. |
|
| formula |
C7H6O3 |
|
| has role | ||
| has_alternative_id |
CHEBI:20398 CHEBI:44949 CHEBI:1858 |
|
| has_exact_synonym |
4-hydroxybenzoic acid 4-Hydroxybenzoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
4-carboxyphenol P-HYDROXYBENZOIC ACID p-salicylic acid p-hydroxybenzoic acid |
|
| id |
CHEBI:30763 |
|
| in_subset | ||
| inchi |
InChI=1S/C7H6O3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H,(H,9,10) |
|
| inchikey |
FJKROLUGYXJWQN-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
4-hydroxybenzoic acid |
|
| mass |
138.12074 |
|
| monoisotopicmass |
138.03169 |
|
| notation |
CHEBI:30763 |
|
| prefLabel |
4-hydroxybenzoic acid |
|
| smiles |
OC(=O)c1ccc(O)cc1 |
|
| subClassOf |