loading...| Preferred Name |
Dextrothyroxine |
|
| Synonyms |
D-thyroxine dextrothyroxine O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-D-tyrosine D-T4 DT4 |
|
| Definitions |
The D-enantiomer of thyroxine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30659 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB00509 Beilstein:2954910 CAS:51-49-0 PMID:15206581 PMID:21035598 PMID:20020587 PMID:2062236 Wikipedia:Dextrothyroxine Drug_Central:846 PMID:20483419 |
|
| definition |
The D-enantiomer of thyroxine. |
|
| formula |
C15H11I4NO4 |
|
| has_exact_synonym |
D-thyroxine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
dextrothyroxine O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-D-tyrosine D-T4 DT4 |
|
| has_RxCUI |
3292 |
|
| id |
CHEBI:30659 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H11I4NO4/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,21H,3,20H2,(H,22,23)/t12-/m1/s1 |
|
| inchikey |
XUIIKFGFIJCVMT-GFCCVEGCSA-N |
|
| is enantiomer of | ||
| label |
D-thyroxine Dextrothyroxine |
|
| mass |
776.87006 |
|
| monoisotopicmass |
776.68669 |
|
| notation |
CHEBI:30659 |
|
| prefLabel |
Dextrothyroxine |
|
| smiles |
N[C@H](Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1)C(O)=O |
|
| subClassOf |