Preferred Name |
benzphetamine |
|
Synonyms |
(2S)-N-benzyl-N-methyl-1-phenylpropan-2-amine Benzphetamine benzfetamine (+)-N-benzyl-N,alpha-dimethylphenethylamine Benzfetamine N-methyl-1-phenyl-N-(phenylmethyl)propan-2-amine (S)-benzphetamine (S)-(+)-N-benzyl-N,alpha-dimethylphenethylamine (+)-benzphetamine (+)-N,alpha-dimethyl-N-(phenylmethyl)-benzeneethanamine benzfetaminum benzaphetamine benzylamphetamine benzfetamina (S)-(+)-benzphetamine (alphaS)-N,alpha-dimethylphenethylamine d-N-methyl-N-benzyl-beta-phenylisopropylamine |
|
Definitions |
Dextroamphetamine in which the the hydrogens attached to the amino group are substituted by a methyl and a benzyl group. A sympathomimetic agent with properties similar to dextroamphetamine, it is used as its hydrochloride salt in the treatment of obesity. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3044 |
|
charge |
0 |
|
database_cross_reference |
KEGG:C07538 DrugBank:DB00865 Beilstein:3203999 Patent:US2789138 KEGG:D07514 Drug_Central:329 CAS:156-08-1 |
|
definition |
Dextroamphetamine in which the the hydrogens attached to the amino group are substituted by a methyl and a benzyl group. A sympathomimetic agent with properties similar to dextroamphetamine, it is used as its hydrochloride salt in the treatment of obesity. |
|
formula |
C17H21N |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_51039 http://purl.obolibrary.org/obo/CHEBI_35524 |
|
has_exact_synonym |
(2S)-N-benzyl-N-methyl-1-phenylpropan-2-amine Benzphetamine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
benzfetamine (+)-N-benzyl-N,alpha-dimethylphenethylamine Benzfetamine N-methyl-1-phenyl-N-(phenylmethyl)propan-2-amine (S)-benzphetamine (S)-(+)-N-benzyl-N,alpha-dimethylphenethylamine (+)-benzphetamine (+)-N,alpha-dimethyl-N-(phenylmethyl)-benzeneethanamine benzfetaminum benzaphetamine benzylamphetamine benzfetamina (S)-(+)-benzphetamine (alphaS)-N,alpha-dimethylphenethylamine d-N-methyl-N-benzyl-beta-phenylisopropylamine |
|
has_RxCUI |
1422 |
|
id |
CHEBI:3044 |
|
in_subset | ||
inchi |
InChI=1S/C17H21N/c1-15(13-16-9-5-3-6-10-16)18(2)14-17-11-7-4-8-12-17/h3-12,15H,13-14H2,1-2H3/t15-/m0/s1 |
|
inchikey |
YXKTVDFXDRQTKV-HNNXBMFYSA-N |
|
label |
benzphetamine Benzphetamine |
|
mass |
239.35530 |
|
monoisotopicmass |
239.16740 |
|
notation |
CHEBI:3044 |
|
prefLabel |
benzphetamine |
|
smiles |
C[C@@H](Cc1ccccc1)N(C)Cc1ccccc1 |
|
subClassOf |