loading...| Preferred Name |
N,N-dimethyltryptamine |
|
| Synonyms |
N,N-Dimethyltryptamine 2-(1H-indol-3-yl)-N,N-dimethylethanamine N,N-dimethyl-1H-indole-3-ethylamine 2-(3-indolyl)ethyldimethylamine 3-(2-dimethylaminoethyl)indole 3-[2-(dimethylamino)ethyl]indole DMT |
|
| Definitions |
A tryptamine derivative having two N-methyl substituents on the side-chain. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28969 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:61-50-7 KNApSAcK:C00001407 KEGG:C08302 Beilstein:138259 |
|
| definition |
A tryptamine derivative having two N-methyl substituents on the side-chain. |
|
| formula |
C12H16N2 |
|
| has functional parent | ||
| has_alternative_id |
CHEBI:21456 CHEBI:7078 |
|
| has_exact_synonym |
N,N-Dimethyltryptamine 2-(1H-indol-3-yl)-N,N-dimethylethanamine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
N,N-dimethyl-1H-indole-3-ethylamine 2-(3-indolyl)ethyldimethylamine 3-(2-dimethylaminoethyl)indole 3-[2-(dimethylamino)ethyl]indole DMT |
|
| id |
CHEBI:28969 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H16N2/c1-14(2)8-7-10-9-13-12-6-4-3-5-11(10)12/h3-6,9,13H,7-8H2,1-2H3 |
|
| inchikey |
DMULVCHRPCFFGV-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
N,N-dimethyltryptamine |
|
| mass |
188.26880 |
|
| monoisotopicmass |
188.13135 |
|
| notation |
CHEBI:28969 |
|
| prefLabel |
N,N-dimethyltryptamine |
|
| smiles |
CN(C)CCc1c[nH]c2ccccc12 |
|
| subClassOf |