loading...| Preferred Name |
triethanolamine |
|
| Synonyms |
triethanolamine 2,2',2''-nitrilotriethanol Triethanolamine 2,2',2''-nitrilotris(ethanol) nitrilotriethanol tris(beta-hydroxyethyl)amine 2,2',2''-NITRILOTRIETHANOL N(CH2CH2OH)3 tris(2-hydroxyethyl)amine nitrilo-2,2',2''-triethanol H3tea TEA Trolamine |
|
| Definitions |
A tertiary amino compound that is ammonia in which each of the hydrogens is substituted by a 2-hydroxyethyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28621 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D00215 PMID:12637103 UM-BBD_compID:c0491 MetaCyc:CPD0-2459 Drug_Central:2768 KEGG:C06771 Reaxys:1699263 PDBeChem:211 PMID:26478337 HMDB:HMDB0032538 CAS:102-71-6 Wikipedia:Triethanolamine PMID:11038241 PMID:15850295 |
|
| definition |
A tertiary amino compound that is ammonia in which each of the hydrogens is substituted by a 2-hydroxyethyl group. |
|
| formula |
C6H15NO3 |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:39717 CHEBI:27108 CHEBI:9707 |
|
| has_exact_synonym |
triethanolamine 2,2',2''-nitrilotriethanol Triethanolamine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2,2',2''-nitrilotris(ethanol) nitrilotriethanol tris(beta-hydroxyethyl)amine 2,2',2''-NITRILOTRIETHANOL N(CH2CH2OH)3 tris(2-hydroxyethyl)amine nitrilo-2,2',2''-triethanol H3tea TEA Trolamine |
|
| has_RxCUI |
38623 |
|
| id |
CHEBI:28621 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H15NO3/c8-4-1-7(2-5-9)3-6-10/h8-10H,1-6H2 |
|
| inchikey |
GSEJCLTVZPLZKY-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
triethanolamine |
|
| mass |
149.18824 |
|
| monoisotopicmass |
149.10519 |
|
| notation |
CHEBI:28621 |
|
| prefLabel |
triethanolamine |
|
| smiles |
OCCN(CCO)CCO |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_27136 |