Preferred Name |
acetamide |
|
Synonyms |
ACETAMIDE Acetamide acetamide Essigsaeureamid acetic acid amide methanecarboxamide Acetamid Azetamid CH3CONH2 Ethanamid ethanamide |
|
Definitions |
A member of the class of acetamides that results from the formal condensation of acetic acid with ammonia. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27856 |
|
charge |
0 |
|
database_cross_reference |
Beilstein:1071207 PDBeChem:ACM LINCS:LSM-37224 KEGG:C06244 CAS:60-35-5 Gmelin:1500 UM-BBD_compID:c0658 DrugBank:DB02736 PPDB:1641 |
|
definition |
A member of the class of acetamides that results from the formal condensation of acetic acid with ammonia. |
|
formula |
C2H5NO |
|
has_alternative_id |
CHEBI:22159 CHEBI:40563 CHEBI:2385 |
|
has_exact_synonym |
ACETAMIDE Acetamide acetamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Essigsaeureamid acetic acid amide methanecarboxamide Acetamid Azetamid CH3CONH2 Ethanamid ethanamide |
|
id |
CHEBI:27856 |
|
in_subset | ||
inchi |
InChI=1S/C2H5NO/c1-2(3)4/h1H3,(H2,3,4) |
|
inchikey |
DLFVBJFMPXGRIB-UHFFFAOYSA-N |
|
is tautomer of | ||
label |
acetamide |
|
mass |
59.06724 |
|
monoisotopicmass |
59.03711 |
|
notation |
CHEBI:27856 |
|
prefLabel |
acetamide |
|
smiles |
CC(N)=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22160 |