Preferred Name |
Practolol |
|
Synonyms |
N-{4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}acetamide practololum 1-(4-acetamidophenoxy)-3-isopropylamino-2-propanol 4'-(2-hydroxy-3-(isopropylamino)propoxy)acetanilide (+-)-practolol N-(4-(2-hydroxy-3-((1-methylethyl)amino)propoxy)phenyl)acetamide practolol |
|
Definitions |
N-(4-Hydroxyphenyl)acetamide in which the hydrogen of the phenolic hydroxy group is substituted by a 3-(isopropylaminoamino)-2-hydroxypropyl group. A selective beta blocker, it has been used in the emergency treatment of cardiac arrhythmias. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_258351 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D05587 DrugBank:DB01297 Patent:US3408387 CAS:6673-35-4 Wikipedia:Practolol LINCS:LSM-1531 KEGG:C11696 Drug_Central:3486 HMDB:HMDB0015411 PMID:6827543 |
|
definition |
N-(4-Hydroxyphenyl)acetamide in which the hydrogen of the phenolic hydroxy group is substituted by a 3-(isopropylaminoamino)-2-hydroxypropyl group. A selective beta blocker, it has been used in the emergency treatment of cardiac arrhythmias. |
|
formula |
C14H22N2O3 |
|
has role | ||
has_alternative_id |
CHEBI:101380 CHEBI:8348 |
|
has_exact_synonym |
N-{4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}acetamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
practololum 1-(4-acetamidophenoxy)-3-isopropylamino-2-propanol 4'-(2-hydroxy-3-(isopropylamino)propoxy)acetanilide (+-)-practolol N-(4-(2-hydroxy-3-((1-methylethyl)amino)propoxy)phenyl)acetamide practolol |
|
has_RxCUI |
8620 |
|
id |
CHEBI:258351 |
|
in_subset | ||
inchi |
InChI=1S/C14H22N2O3/c1-10(2)15-8-13(18)9-19-14-6-4-12(5-7-14)16-11(3)17/h4-7,10,13,15,18H,8-9H2,1-3H3,(H,16,17) |
|
inchikey |
DURULFYMVIFBIR-UHFFFAOYSA-N |
|
label |
Practolol practolol |
|
mass |
266.33610 |
|
monoisotopicmass |
266.16304 |
|
notation |
CHEBI:258351 |
|
prefLabel |
Practolol |
|
smiles |
CC(C)NCC(O)COc1ccc(NC(C)=O)cc1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35533 http://purl.obolibrary.org/obo/CHEBI_50995 http://purl.obolibrary.org/obo/CHEBI_23981 |