Preferred Name |
acrylic acid |
|
Synonyms |
Propenoic acid 2-Propenoic acid acroleic acid ethylenecarboxylic acid Vinylformic acid Acrylate Propenoate prop-2-enoic acid ACRYLIC ACID Acrylic acid |
|
Definitions |
A alpha,beta-unsaturated monocarboxylic acid that is ethene substituted by a carboxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_18308 |
|
alternative label |
Propenoic acid 2-Propenoic acid acroleic acid ethylenecarboxylic acid Vinylformic acid Acrylate Propenoate prop-2-enoic acid ACRYLIC ACID Acrylic acid |
|
charge |
0 |
|
database_cross_reference |
PMID:24650085 Wikipedia:Acrylic_acid CAS:79-10-7 Gmelin:1817 DrugBank:DB02579 Beilstein:635743 LIPID_MAPS_instance:LMFA01030193 MetaCyc:MY148411 PMID:24673501 Reaxys:635743 KEGG:C00511 MetaCyc:MY149879 HMDB:HMDB0031647 PDBeChem:AKR |
|
definition |
A alpha,beta-unsaturated monocarboxylic acid that is ethene substituted by a carboxy group. |
|
formula |
C3H4O2 |
|
has role | ||
has_alternative_id |
CHEBI:40714 CHEBI:19766 CHEBI:19768 CHEBI:35853 CHEBI:8487 |
|
has_exact_synonym |
prop-2-enoic acid ACRYLIC ACID Acrylic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Propenoic acid 2-Propenoic acid acroleic acid ethylenecarboxylic acid Vinylformic acid Acrylate Propenoate |
|
id |
CHEBI:18308 |
|
in_subset | ||
inchi |
InChI=1S/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5) |
|
inchikey |
NIXOWILDQLNWCW-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
acrylic acid |
|
mass |
72.06266 |
|
monoisotopicmass |
72.02113 |
|
notation |
CHEBI:18308 |
|
prefLabel |
acrylic acid |
|
smiles |
OC(=O)C=C |
|
subClassOf |