loading...| Preferred Name |
5-methoxypsoralen |
|
| Synonyms |
5-Methoxyfuranocoumarin 4-methoxy-7H-furo[3,2-g][1]benzopyran-7-one O-Methylbergaptol 5-methoxypsoralene Bergapten Bergaptene Heraclin Majudin bergapten 4-methoxy-7H-furo[3,2-g]chromen-7-one 5-Methoxypsoralen |
|
| Definitions |
A 5-methoxyfurocoumarin that is psoralen substituted by a methoxy group at position 5. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18293 |
|
| alternative label |
5-Methoxyfuranocoumarin 4-methoxy-7H-furo[3,2-g][1]benzopyran-7-one O-Methylbergaptol 5-methoxypsoralene Bergapten Bergaptene Heraclin Majudin bergapten 4-methoxy-7H-furo[3,2-g]chromen-7-one 5-Methoxypsoralen |
|
| database_cross_reference |
CAS:484-20-8 KNApSAcK:C00000575 MetaCyc:5-METHOXYFURANOCOUMARIN LINCS:LSM-20001 Wikipedia:Bergapten KEGG:D07521 HMDB:HMDB0030637 PMID:22611312 Reaxys:19560 PMID:20433072 KEGG:C01557 Drug_Central:3021 |
|
| definition |
A 5-methoxyfurocoumarin that is psoralen substituted by a methoxy group at position 5. |
|
| formula |
C12H8O4 |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:20599 CHEBI:21959 CHEBI:12142 CHEBI:12714 CHEBI:2087 CHEBI:3067 |
|
| has_exact_synonym |
4-methoxy-7H-furo[3,2-g]chromen-7-one 5-Methoxypsoralen |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
5-Methoxyfuranocoumarin 4-methoxy-7H-furo[3,2-g][1]benzopyran-7-one O-Methylbergaptol 5-methoxypsoralene Bergapten Bergaptene Heraclin Majudin bergapten |
|
| has_RxCUI |
15842 |
|
| id |
CHEBI:18293 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H8O4/c1-14-12-7-2-3-11(13)16-10(7)6-9-8(12)4-5-15-9/h2-6H,1H3 |
|
| inchikey |
BGEBZHIAGXMEMV-UHFFFAOYSA-N |
|
| label |
5-methoxypsoralen |
|
| monoisotopicmass |
216.04226 |
|
| notation |
CHEBI:18293 |
|
| prefLabel |
5-methoxypsoralen |
|
| smiles |
COc1c2ccoc2cc2oc(=O)ccc12 |
|
| subClassOf |