loading...| Preferred Name |
Thymine |
|
| Synonyms |
THYMINE Thymine thymine 5-methyl-2,4(1H,3H)-pyrimidinedione 5-methylpyrimidine-2,4(1H,3H)-dione 5-Methyluracil 2,4-dihydroxy-5-methylpyrimidine 5-methyluracil T Thy Thymin |
|
| Definitions |
A pyrimidine nucleobase that is uracil in which the hydrogen at position 5 is replaced by a methyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17821 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB03462 Wikipedia:Thymine KEGG:C00178 PMID:23237383 KNApSAcK:C00001511 Gmelin:278790 PDBeChem:TDR CAS:65-71-4 Beilstein:607626 |
|
| definition |
A pyrimidine nucleobase that is uracil in which the hydrogen at position 5 is replaced by a methyl group. |
|
| formula |
C5H6N2O2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_77746 |
|
| has_alternative_id |
CHEBI:15247 CHEBI:46017 CHEBI:27004 CHEBI:9580 |
|
| has_exact_synonym |
THYMINE Thymine thymine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
5-methyl-2,4(1H,3H)-pyrimidinedione 5-methylpyrimidine-2,4(1H,3H)-dione 5-Methyluracil 2,4-dihydroxy-5-methylpyrimidine 5-methyluracil T Thy Thymin |
|
| has_RxCUI |
1368871 |
|
| id |
CHEBI:17821 |
|
| in_subset | ||
| inchi |
InChI=1S/C5H6N2O2/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9) |
|
| inchikey |
RWQNBRDOKXIBIV-UHFFFAOYSA-N |
|
| label |
Thymine thymine |
|
| mass |
126.11342 |
|
| monoisotopicmass |
126.04293 |
|
| notation |
CHEBI:17821 |
|
| prefLabel |
Thymine |
|
| smiles |
Cc1c[nH]c(=O)[nH]c1=O |
|
| subClassOf |