loading...| Preferred Name |
niraparib |
|
| Synonyms |
2-{4-[(3S)-piperidin-3-yl]phenyl}-2H-indazole-7-carboxamide 2-[4-[(3S)-piperidin-3-yl]phenyl]indazole-7-carboxamide niraparibum 2-[4-(3S)-3-piperidinylphenyl]-2H-indazole-7-carboxamide MK 4827 MK-4827 MK4827 Zejula niraparib |
|
| Definitions |
A 2-[4-(piperidin-3-yl)phenyl]-2H-indazole-7-carboxamide that has S-configuration. It is a potent inhibitor of PARP1 and PARP2 (IC50 of 3.8 and 2.1 nM, respectively) and approved as a first-line maintenance treatment for women with advanced ovarian cancer after responding to platinum-based chemotherapy. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_176844 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:32863940 PMID:33993885 PMID:31857852 PMID:33774805 PMID:34164503 PMID:33407715 PMID:19873981 PMID:34073147 PMID:29856239 PMID:33361107 Chemspider:24531930 Drug_Central:5222 PMID:33470063 PMID:23482742 PMID:32679152 PMID:32073931 PMID:33920140 KEGG:D10140 PMID:34241562 PMID:29081841 PMID:33559417 PMID:30096696 PMID:33641880 Patent:KR20100114021 CAS:1038915-60-4 PMID:34327724 PMID:33905671 PMID:33915252 DrugBank:DB11793 PMID:33545804 PMID:29214031 PMID:33621324 PMID:28001384 PDBeChem:3JD PMID:32753559 PMID:34307148 Wikipedia:Niraparib PMID:33691564 PMID:34324028 PMID:24970803 |
|
| definition |
A 2-[4-(piperidin-3-yl)phenyl]-2H-indazole-7-carboxamide that has S-configuration. It is a potent inhibitor of PARP1 and PARP2 (IC50 of 3.8 and 2.1 nM, respectively) and approved as a first-line maintenance treatment for women with advanced ovarian cancer after responding to platinum-based chemotherapy. |
|
| formula |
C19H20N4O |
|
| has role | ||
| has_exact_synonym |
2-{4-[(3S)-piperidin-3-yl]phenyl}-2H-indazole-7-carboxamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-[4-[(3S)-piperidin-3-yl]phenyl]indazole-7-carboxamide niraparibum 2-[4-(3S)-3-piperidinylphenyl]-2H-indazole-7-carboxamide MK 4827 MK-4827 MK4827 Zejula niraparib |
|
| has_RxCUI |
1918231 |
|
| id |
CHEBI:176844 |
|
| in_subset | ||
| inchi |
InChI=1S/C19H20N4O/c20-19(24)17-5-1-3-15-12-23(22-18(15)17)16-8-6-13(7-9-16)14-4-2-10-21-11-14/h1,3,5-9,12,14,21H,2,4,10-11H2,(H2,20,24)/t14-/m1/s1 |
|
| inchikey |
PCHKPVIQAHNQLW-CQSZACIVSA-N |
|
| label |
niraparib |
|
| mass |
320.396 |
|
| monoisotopicmass |
320.16371 |
|
| notation |
CHEBI:176844 |
|
| prefLabel |
niraparib |
|
| smiles |
[H][C@]1(CCCNC1)C1=CC=C(C=C1)N1C=C2C=CC=C(C(N)=O)C2=N1 |
|
| subClassOf |