loading...| Preferred Name |
4-aminophenol |
|
| Synonyms |
4-aminophenol 4-Aminophenol 4-AMINOPHENOL p-Aminophenol p-hydroxyaniline 4-Aminobenzenol 4-Hydroxyaniline |
|
| Definitions |
An amino phenol (one of the three possible isomers) which has the single amino substituent located para to the phenolic -OH group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17602 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:385836 PDBeChem:4NL Wikipedia:4-Aminophenol HMDB:HMDB0001169 CAS:123-30-8 PMID:1395635 MetaCyc:CPD-259 PMID:11304127 Beilstein:385836 UM-BBD_compID:c0090 Gmelin:2926 KEGG:C02372 PMID:22770225 PMID:7179289 |
|
| definition |
An amino phenol (one of the three possible isomers) which has the single amino substituent located para to the phenolic -OH group. |
|
| formula |
C6H7NO |
|
| has role | ||
| has_alternative_id |
CHEBI:40037 CHEBI:20395 CHEBI:12001 CHEBI:1856 |
|
| has_exact_synonym |
4-aminophenol 4-Aminophenol 4-AMINOPHENOL |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
p-Aminophenol p-hydroxyaniline 4-Aminobenzenol 4-Hydroxyaniline |
|
| id |
CHEBI:17602 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H7NO/c7-5-1-3-6(8)4-2-5/h1-4,8H,7H2 |
|
| inchikey |
PLIKAWJENQZMHA-UHFFFAOYSA-N |
|
| label |
4-aminophenol |
|
| mass |
109.12592 |
|
| monoisotopicmass |
109.05276 |
|
| notation |
CHEBI:17602 |
|
| prefLabel |
4-aminophenol |
|
| smiles |
Nc1ccc(O)cc1 |
|
| subClassOf |