loading...| Preferred Name |
L-asparagine |
|
| Synonyms |
L-asparagine L-Asparagine alpha-aminosuccinamic acid (S)-Asparagine (2S)-2,4-diamino-4-oxobutanoic acid L-aspartic acid beta-amide L-Asparagin 2-Aminosuccinamic acid L-2-aminosuccinamic acid (S)-2-amino-3-carbamoylpropanoic acid (2S)-2-amino-3-carbamoylpropanoic acid Aspartamic acid ASPARAGINE Asn N |
|
| Definitions |
An optically active form of asparagine having L-configuration. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17196 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:1723527 PMID:21800258 Wikipedia:Asparagine YMDB:YMDB00226 PMID:16190636 PMID:21854356 PDBeChem:ASN FooDB:FDB000787 PMID:12142634 PMID:16368161 DrugBank:DB00174 CAS:70-47-3 Reaxys:1723527 PMID:16668324 Drug_Central:4126 ECMDB:ECMDB00168 PMID:17497286 PMID:15907185 KEGG:C00152 KNApSAcK:C00001341 MetaCyc:ASN PMID:22513289 Gmelin:3334 HMDB:HMDB0000168 |
|
| definition |
An optically active form of asparagine having L-configuration. |
|
| formula |
C4H8N2O3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_27027 |
|
| has_alternative_id |
CHEBI:40902 CHEBI:21242 CHEBI:13083 CHEBI:6191 |
|
| has_exact_synonym |
L-asparagine L-Asparagine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
alpha-aminosuccinamic acid (S)-Asparagine (2S)-2,4-diamino-4-oxobutanoic acid L-aspartic acid beta-amide L-Asparagin 2-Aminosuccinamic acid L-2-aminosuccinamic acid (S)-2-amino-3-carbamoylpropanoic acid (2S)-2-amino-3-carbamoylpropanoic acid Aspartamic acid ASPARAGINE Asn N |
|
| id |
CHEBI:17196 |
|
| in_subset | ||
| inchi |
InChI=1S/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9)/t2-/m0/s1 |
|
| inchikey |
DCXYFEDJOCDNAF-REOHCLBHSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-asparagine |
|
| mass |
132.11800 |
|
| monoisotopicmass |
132.05349 |
|
| notation |
CHEBI:17196 |
|
| prefLabel |
L-asparagine |
|
| smiles |
N[C@@H](CC(N)=O)C(O)=O |
|
| subClassOf |