Preferred Name |
cytosine |
|
Synonyms |
4-aminopyrimidin-2(1H)-one Cytosine cytosine 4-amino-2(1H)-pyrimidinone 4-amino-2-hydroxypyrimidine C Cyt Cytosin Zytosin |
|
Definitions |
An aminopyrimidine that is pyrimidin-2-one having the amino group located at position 4. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16040 |
|
charge |
0 |
|
database_cross_reference |
PMID:7877593 Beilstein:2637 KNApSAcK:C00001498 Wikipedia:Cytosine Reaxys:2637 KEGG:C00380 PMID:14253484 PMID:22770225 MetaCyc:CYTOSINE Gmelin:82472 HMDB:HMDB0000630 CAS:71-30-7 PDBeChem:CYT |
|
definition |
An aminopyrimidine that is pyrimidin-2-one having the amino group located at position 4. |
|
formula |
C4H5N3O |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 |
|
has_alternative_id |
CHEBI:41732 CHEBI:23531 CHEBI:14066 CHEBI:4072 |
|
has_exact_synonym |
4-aminopyrimidin-2(1H)-one Cytosine cytosine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
4-amino-2(1H)-pyrimidinone 4-amino-2-hydroxypyrimidine C Cyt Cytosin Zytosin |
|
id |
CHEBI:16040 |
|
in_subset | ||
inchi |
InChI=1S/C4H5N3O/c5-3-1-2-6-4(8)7-3/h1-2H,(H3,5,6,7,8) |
|
inchikey |
OPTASPLRGRRNAP-UHFFFAOYSA-N |
|
label |
cytosine |
|
mass |
111.10212 |
|
monoisotopicmass |
111.04326 |
|
notation |
CHEBI:16040 |
|
prefLabel |
cytosine |
|
smiles |
Nc1cc[nH]c(=O)n1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38337 |