loading...| Preferred Name |
dehydroacetic acid |
|
| Synonyms |
3-acetyl-6-methyl-2H-pyran-2,4(3H)-dione Biocide 470F Methylacetopyronone |
|
| Definitions |
A pyran-2,4-dione substituted at position 3 by an acetyl group and at position 6 by a methyl group. A fungicide and bactericide it is used primarily in processed fruit and vegetables. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_137426 |
|
| charge |
0 |
|
| database_cross_reference |
Patent:AU2004287448 PMID:6885696 Wikipedia:Dehydroacetic_acid PMID:23790920 Patent:US3849579 PMID:18960990 PMID:28166217 CAS:520-45-6 AGR:IND87014549 PMID:25813167 PMID:4030634 |
|
| definition |
A pyran-2,4-dione substituted at position 3 by an acetyl group and at position 6 by a methyl group. A fungicide and bactericide it is used primarily in processed fruit and vegetables. |
|
| formula |
C8H8O4 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_24127 |
|
| has_exact_synonym |
3-acetyl-6-methyl-2H-pyran-2,4(3H)-dione |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Biocide 470F Methylacetopyronone |
|
| has_RxCUI |
1312367 |
|
| id |
CHEBI:137426 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H8O4/c1-4-3-6(10)7(5(2)9)8(11)12-4/h3,7H,1-2H3 |
|
| inchikey |
PGRHXDWITVMQBC-UHFFFAOYSA-N |
|
| label |
dehydroacetic acid |
|
| mass |
168.147 |
|
| monoisotopicmass |
168.04226 |
|
| notation |
CHEBI:137426 |
|
| prefLabel |
dehydroacetic acid |
|
| smiles |
C1(C(C(C=C(O1)C)=O)C(=O)C)=O |
|
| subClassOf |