loading...| Preferred Name |
Levomefolic Acid |
|
| Synonyms |
N-[4-({[(6S)-2-amino-5-methyl-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)benzoyl]-L-glutamic acid L-5-methyltetrahydrofolic acid acido levomefolico acidum levomefolicum L-5-methyltetrahydrofolate (6S)-5-methyl-5,6,7,8-tetrahydrofolic acid acide levomefolique (6S)-5-methyl-THF (6S)-5-methylTHFA levomefolic acid |
|
| Definitions |
A 5-methyltetrahydrofolic acid that has 6S-configuration. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_136009 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:33925570 Wikipedia:Levomefolic_acid KEGG:D09353 PMID:33375730 PMID:15612825 Drug_Central:4621 PMID:17622258 PMID:32370802 Chemspider:392351 PDBeChem:C2F PMID:34953391 HMDB:HMDB0254053 PMID:20423084 Patent:US2010151533 PMID:33255787 Patent:US2007190596 CAS:31690-09-2 |
|
| definition |
A 5-methyltetrahydrofolic acid that has 6S-configuration. |
|
| formula |
C20H25N7O6 |
|
| has_alternative_id |
CHEBI:41381 |
|
| has_exact_synonym |
N-[4-({[(6S)-2-amino-5-methyl-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)benzoyl]-L-glutamic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
L-5-methyltetrahydrofolic acid acido levomefolico acidum levomefolicum L-5-methyltetrahydrofolate (6S)-5-methyl-5,6,7,8-tetrahydrofolic acid acide levomefolique (6S)-5-methyl-THF (6S)-5-methylTHFA levomefolic acid |
|
| has_RxCUI |
1025342 |
|
| id |
CHEBI:136009 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H25N7O6/c1-27-12(9-23-16-15(27)18(31)26-20(21)25-16)8-22-11-4-2-10(3-5-11)17(30)24-13(19(32)33)6-7-14(28)29/h2-5,12-13,22H,6-9H2,1H3,(H,24,30)(H,28,29)(H,32,33)(H4,21,23,25,26,31)/t12-,13-/m0/s1 |
|
| inchikey |
ZNOVTXRBGFNYRX-STQMWFEESA-N |
|
| is conjugate acid of | ||
| label |
Levomefolic Acid (6S)-5-methyltetrahydrofolic acid |
|
| mass |
459.463 |
|
| monoisotopicmass |
459.18663 |
|
| notation |
CHEBI:136009 |
|
| prefLabel |
Levomefolic Acid |
|
| smiles |
CN1[C@@H](CNC2=CC=C(C=C2)C(=O)N[C@@H](CCC(O)=O)C(O)=O)CNC2=C1C(=O)NC(N)=N2 |
|
| subClassOf |